Hardstyle 2007 Scene Releases

Mar 2011
320 kbps
Average: 10 (1 vote)

all releases passed sfv check
updated: 15/12/2014
size: 56,5 GB
releases: 1272


2_Best_Enemies-Les_Drums-(POLL286)-WEB-2007-hM (CBR 320 kbps)
2_Best_Enemys_-_Les_Drums_(POLL286)-Vinyl-2007-JiM (VBR V2)
2_Brothers_Of_Hardstyle-Techno_Bastard_(SIGMA134)-READ_NFO-Vinyl-2007-NBD (VBR V2)
2b4th_-_Never_Alone_2-(23-22301-6)-Vinyl-2007-HB (VBR V2)
2b4th-Never_Alone_2-CDS-2007-GTi (VBR V2)
4_Navigators_Feat_Vorluk_-_Warrior-Vinyl-2007-QMI (VBR V2)
A.L.A.N._-_Mindcontrol__U.F.O.-(NZ001)-Vinyl-2007-HB (VBR V2)
Abject_-_Brain_Insane-(BOOTLEG)-2007-Jolf (VBR V2)
Abject_-_In_Our_Memories-(NC005)-Vinyl-2007-HB (VBR V2)
Abject_-_In_Our_Memories__My_Dome-(NC005)-WEB-2007-gnvr (CBR 320 kbps)
Accuface_-_Let_Your_Mind_Fly_2007-Vinyl-2007-QMI (VBR V2)
Acid_Bunny_Feat._resq-creepy_game_(GRC069)-Vinyl-2007-NBD (VBR V2)
Acl_Team_-_Rock_Your_Frequency__Wrong_Tone-Promo_Vinyl-2007-TQP (VBR V2)
Acti_-_Im_A_Natural_Born_DJ_(ACT70)-2007-DBT (CBR 320 kbps)
Acti_And_Vorti_-_Raw-WEB-2007-Homely (CBR 320 kbps)
Acti_And_Vorti-Raw-Vinyl-2007-SND (VBR V2)
Activator_And_Zatox-Get_Drunk-Vinyl-2007-SND (VBR V2)
Activator_Vs_Zatox-Get_Drunk-(ACT072)-WEB-2007-Homely (CBR 320 kbps)
Addicted_Craze_Feat_The_Circus-Beautiful-Promo_CDM-2007-BWA (VBR V2)
Ado_The_Dream_-_Fire-(GEE088)-WEB-2007-gnvr (CBR 320 kbps)
Ado_The_Dream_-_Fire_(GEE088)-Vinyl-2007-NBD (VBR V2)
A-Drive_-_Sex_Drugs_And_House-Vinyl-2007-QMI (VBR V2)
A-Drive_-_The_Remixes-(SPR007)-Promo_Vinyl-2007-HB (VBR V2)
A-Drive_Ft._matti_and_c-sar-mobster__ave_c-sar_(SPR005)-Vinyl-2007-NBD (VBR V2)
A-Drive-No_Coca_No_Party_(BELT011)-Vinyl-2007-NBD (VBR V2)
Aj_Busta-I_Grown_It_(KAT046)-Vinyl-2007-NBD (VBR V2)
Alex_Kidd_Vs_Novacaine-Wot_Da_Fuk_(MASIFSAMPLER5)-Vinyl-2007-NBD (VBR V2)
Alphaverb_-_Shake_The_Place_Ep_Part_1-(BIR002)-Vinyl-2007-HB (VBR V2)
Alphaverb-Shake_The_Place_Ep_Part_1-(BIR002)-WEB-2007-hM (CBR 320 kbps)
Alphaverb-Shake_The_Place_Ep1-(BIR002)-READ_NFO-WEB-2007-DFM (CBR 320 kbps)
A-Lusion_-_Be_Yourself-(SCSP014)-Vinyl-2007-HB (VBR V2)
A-Lusion_-_The_4_Elementz-(SCSP015)-Vinyl-2007-HB (VBR V2)
A-Lusion_-_The_4_Elementz__Talk_Iz_The_Rmx-(SCSP015)-WEB-2007-HB (CBR 320 kbps)
A-Lusion-Be_Yourself__Freeek_It_Up-(SCSP014)-WEB-2007-gnvr (CBR 320 kbps)
Analogic_Disturbance_-_Pray_For_Your_Future_(TEC144)-Vinyl-2007-NBD (VBR V2)
Andrea_Montorsi-Dont_Leave_Me-Vinyl-2007-MTC (VBR V2)
Andrew_Spencer_and_The_Vamprockerz_-_Zombie-(MMR125)-READ_NFO-Vinyl-2007-FMC (VBR V2)
Andy_Jay_Powell_-_Triple_X-Promo_Vinyl-2007-QMI (VBR V2)
Andy-J_meets_Lockhard_-_Bass_Comes_Loud-CDM-2007-TNS (VBR V0)
Anonymous_-_U_Got_2_Know-(23-221446)-Vinyl-2007-HB (VBR V2)
Anonymous-Control__Virtual_Zone-CDS-2007-DOC (VBR V2)
Anonymous-Control_Ep_(2322395-6)-Vinyl-2007-NBD (VBR V2)
Ant_Vs_Nick_Grater_-_Colombias_Finest-(PTS036)-Vinyl-2007-FMC (VBR V2)
Antonio_And_Cristiano_Vs._Photonic-Ragga_Jump__Outland_(TTJ006)-Vinyl-2007-NBD (VBR V2)
Antonio_and_Cristiano_Vs_Photonic_-_Ragga_Jump__Outland-(TTJ006)-WEB-2007-iHQ (CBR 320 kbps)
Apex_Mind_-_Demons_From_Hell-Vinyl-2007-QMI (VBR V2)
Apex_Mind_And_Stereo_Freax_-_Make_Your_Choice-(IMPR02)-WEB-2007-iHQ (CBR 320 kbps)
Apex_Mind_And_Stereo_Freax-Make_Your_Choice_(IMPR-02)-Vinyl-2007-NBD (VBR V2)
Appolon_-_Lovesick__Incl_Dj_Pat_B_Remix-Vinyl-2007-QMI (VBR V2)
Asys_-_Cheers-Cdm-2007-QMI (VBR V2)
Asys-Cheers__Incl_Dj_Zany_Remix-Promo_Vinyl-2007-SDS (VBR V2)
Asys-Lost_In_Acid-(FE001)-WEB-2007-eST (CBR 320 kbps)
Audio_Damage_-_Breaking_The_Chains_Ep-Vinyl-2007-QMI (VBR V2)
Audio_Damage_-_Breaking_the_Chains_EP-WEB-2007-eST_INT (CBR 320 kbps)
Audio_Damage_-_Pain__Attack_The_Club_(FTS055)-Vinyl-2007-NBD (VBR V2)
Audio_Damage-Breaking_The_Chains_E.P.-WEB-2007-Homely (VBR V2)
Automatic_Djz_-_Mad_Lay_Number_Four-(GEE086)-WEB-2007-TRa (CBR 320 kbps)
Baced_Meets_Ultraform_-_Im_In_Your_Head_Mistress_Of_Darkness-Proper-Vinyl-2007-QMI (VBR V2)
Baced_Meets_Ultraform_-_Im_In_Your_Head-TRACKFIX-Vinyl-2007-QMI (VBR V2)
Baced_Meets_Ultraform-Paintings_Of_The_Old_Master-(VENOM009)-Vinyl-2007-TWCMP3 (VBR V2)
Bass_Alliance_-_Fight_Club__Get_Up-Vinyl-2007-QMI (VBR V2)
Bass_Alliance_-_Party_People__B-Side-Promo_Vinyl-2007-QMI (VBR V2)
Bassbusters_Vs_Dj_Mystery_-_Hardstyle_Ep-Vinyl-2007-QMI (VBR V2)
Bassdrum_Project-E.P._Vol._I-(CHR-537)-WEB-2007-MK2 (CBR 320 kbps)
Bassdrum_Project-E.P._Vol._ii-(CHR-542)-WEB-2007-MK2 (CBR 320 kbps)
Bassdrum_Project-E.P._Vol._III-(CHR-573)-WEB-2007-MK2 (CBR 320 kbps)
Bassrave_-_The_Anthem_2007-Vinyl-2007-QMI (VBR V2)
Bazzpitchers_-_We_Are_One__Incl_Maziano_Remix_Edit-(MMR130)-WEB-2007-eST (CBR 320 kbps)
Bazzy_Boy_-_Labtec_Ep-Promo_Vinyl-2007-QMI (VBR V2)
Beat_Suckers-Control_Music__Rock_Back-(GRC068)-Vinyl-2007-MTC (VBR V2)
Beats_Of_Genesis_Vs_Legend_B-Lost_In_Love_2k7__Incl_Philippe_Rochard_Remix-Vinyl-2007-SDS (VBR V2)
Ben_(9mm)_Vs_Ekeaze-Acid_23-(EK03)-Vinyl-2007-hM (VBR V2)
Berliner_Old_Skool-Shit_Ep-(23221476)-Vinyl-2007-HDF (VBR V2)
Big_Ben_And_Dark_By_Design_-_Rip_Groove-Onesided_Vinyl-2007-QMI (VBR V2)
Binary_Inc_-_Youre_Going_Out__Fuck_My_Sister-(ST4314)-WEB-2007-FQS (VBR V2)
Binum_-_Old_School_EP_3-(BABA002)-Vinyl-2007-HB (VBR V2)
Binum_-_Old_School_EP_4-(BABA005)-Vinyl-2007-HB (VBR V2)
Binum_Vs._Mr._Fillz_-_Work_It-(BABA075)-Vinyl-2007-LiR (VBR V2)
Bioniq_Deejays-The_Rebirth_(EB005)-Vinyl-2007-NBD (VBR V2)
Bitch_Boys_-_Back_On_The_Block_Ep-(TB002)-Vinyl-2007-HB (VBR V2)
Bjorn_Smith_Feat._matt_b_-_nice_ass_(WA025)-Vinyl-2007-UNiCORN (VBR V2)
Bk-X_-_Make_Your_Move_(LIVINGRM003)-Vinyl-2007-NBD (VBR V2)
Black_And_White_-_Dirty_Games_(Incl_Tatanka_Remix)_(POLL283)-Vinyl-2007-NBD (VBR V2)
Black_and_White-Dirty_Games-POLL283-WEB-2007-JUSTiFY (CBR 320 kbps)
Black_Identity_-_Blckr_Thn_Blck-(SCANTRAXX031)-Vinyl-2007-HB (VBR V2)
Black_Identity_-_Blckr_Thn_Blck-(SCANTRAXX031)-WEB-2007-HB_INT (CBR 320 kbps)
Blademasterz_aka_Brennan_Heart-Audio_Care-CDR-2007-QHS (VBR V0)
Blutonium_Boy_-_Dark_Angel_(INCL_SHORT_MIXES)-WEB-READ_NFO-2007-Homely (CBR 320 kbps)
Blutonium_Boy_-_Dark_Angel_(REMIXES)-WEB-2007-eST (CBR 192 kbps)
Blutonium_Boy_-_Dark_Angel__Hardstyle_Instructor_Returns-(BLU123)-WEB-2007-eST (CBR 192 kbps)
Blutonium_Boy_-_Dark_Angel__Hardstyle_Instructor-Vinyl-2007-QMI (VBR V2)
Blutonium_Boy_Joins_Luna_-_Blackout__Fear-(BLU121)-WEB-2007-eST (CBR 320 kbps)
Blutonium_Boy_Joins_Luna_-_Blackout__Fear-Vinyl-2007-QMI (VBR V2)
Blutonium_Boys_-_Use_Me__XTC-(BLU128)-WEB-2007-eST (CBR 320 kbps)
Bob_Sinclar_And_Cutee_B_-_Rock_This_Party_(DJ_W4CKO_Remix)-(541416501674)-Onesided_Vinyl-2007-HB (VBR V2)
Boogiemen_-_Wap_Bam_Boogie_(BAMBU003)-Vinyl-2007-NBD (VBR V2)
Brainblaster-Soulblaster-(CHR-618)-Vinyl-2007-OBC (VBR V2)
Brainheadz-100_Percent-(HS0326)-WEB-2007-eST (CBR 320 kbps)
Brainkicker_And_Friends_-_Black_Justice_E.P._(DJU019)-Vinyl-2007-NBD (VBR V2)
Brainkicker_And_Friends-Black_Justice_Ep-WEB-2007-Homely (CBR 320 kbps)
Brainkicker_vs._Bass_Modulators_-_Fight_The_Future__Ring_That_Shit-WEB-2007-SRG (CBR 192 kbps)
Brainkicker-F.M.W.-(DJU-021)-WEB-2007-hM (CBR 192 kbps)
Break_Sun_Project-I_Walk_Alone-Vinyl-2007-SDS (VBR V2)
Brennan_Heart_-_Get_Wasted_(Defqon_One_Festival_Anthem_2007)-(Q036)-READ_NFO-WEB-2007-HB_INT (CBR 320 kbps)
Brennan_Heart_-_Get_Wasted_(Defqon_One_Festival_Anthem_2007)-(Q036)-Vinyl-2007-HB (VBR V2)
Brennan_Heart_-_Rush_The_Rmx-(MY005)-WEB-2007-HB_INT (CBR 320 kbps)
Brennan_Heart_-_Rush_The_Rmx-(MY005)-WEB-2007-Homely (CBR 192 kbps)
Brennan_Heart_Aka_Blademasterz_-_One_Blade-(MY006)-Promo_Vinyl-2007-HB (VBR V2)
Brennan_Heart_Aka_Blademasterz_-_One_Blade__Equal_Phunk-(MY006)-WEB-2007-HB (CBR 320 kbps)
Brennan_Heart_Aka_Blademasterz-One_Blade-(PROMO_CDS)-2007-Rullstol (VBR V2)
Brennan_Heart-Rush_the_RMX-(MY005)-Promo_Vinyl-2007-HDF (VBR V2)
Brian_M_Vs_Mcbunn_-_Vibrations__Masterbeatz-(BLU124)-Vinyl-2007-FMC (VBR V2)
Brooklyn_Bounce_-_The_Theme_Recall_08-Vinyl-2007-QMI (VBR V2)
Bruno_Power_-_Superbattlerz-(BTE009)-Vinyl-2007-HB (VBR V2)
Builder_-_Her_Voice-(POLL281)-WEB-2007-JiM (CBR 320 kbps)
Builder_-_Her_Voice-Vinyl-2007-QMI (VBR V2)
Bulldozzer_-_Pump_It_Up__Bring_The_Beat_Back-Vinyl-2007-QMI (VBR V2)
Busta_Rhymes-Watch_Ya_Mouth_(Feat._Swizz_Beatz)-(PROMO_VLS)-2007-C4 (VBR V2)
Caffeine_Vs_Bizerk_-_Juke-(EXP045)-Vinyl-2007-NBD (VBR V2)
Caffeine_vs_Bizerk_-_Juke-(EXP045)-WEB-2007-HB (CBR 320 kbps)
Candyman_-_Kiss_The_Girls-(ZOO024)-Vinyl-2007-HB (VBR V2)
Candyman_-_Kiss_the_Girls-(ZOO024)-WEB-2007-iHQ (CBR 320 kbps)
Carnifex_-_Firefight_EP-(EXP049)-WEB-2007-HB (CBR 320 kbps)
Carnifex-Firefight_Ep-Vinyl-2007-SND (VBR V2)
Chaps_And_Rolay_-_Family_Affairs-(DTX007)-Vinyl-2007-HB (VBR V2)
Charly_Lownoise_And_Mental_Theo_-_Wonderful_Days_2.08__Showtek_Remix-Vinyl-2007-QMI (VBR V2)
Charly_Lownoise_And_Mental_Theo-Wonderfull_Days_2.08_(The_Remixes)-(RETAIL_CDM)-2007-gnvr (VBR V2)
Cherry_Moon_Trax_-_Acid_Dream_(THE_PROPHET_REMIX)-WEB-2007-Homely (CBR 192 kbps)
Cherry_Moon_Trax_-_Acid_Dream_2007_Remixes-Vinyl-2007-QMI (VBR V2)
Chicago_Zone_-_Hands_Up-(KOJ07)-Vinyl-2007-HB (VBR V2)
Chicago_Zone_-_Private_Projection-(Dr_Rude_Remix)-Promo-WEB-2007-JFF (VBR)
Chicago_Zone_-_Scanner-(KOJ01)-Vinyl-2007-HB (VBR V2)
Chicago_Zone_And_Electrostan_-_Reactor-(RM072)-Vinyl-2007-HB (VBR V2)
Chocolate_-_Da_Club_(CHR607)-Vinyl-2007-NRG (VBR V2)
Chocolate-Da_Club-(CON-371-CD)-2CD-2007-OBC (VBR V2)
Christian_Smith-Finca_Dofi-CDS-2007-MNS (VBR V2)
Circle_K_And_Jimmy_X-Harder_Equals_Better_EP-Vinyl-2007-SDS (VBR V2)
Citizen_-_1980-(BLQ051)-WEB-2007-iHQ (CBR 320 kbps)
Citizen_-_If_I_Say_Stop-Vinyl-2007-QMI (VBR V2)
Citizen-If_I_Say_Stop-(BLQ047)-WEB-2007-DFM (CBR 320 kbps)
Cliff_Raafs_-_Talk_To_Me_(AKS003)-Vinyl-2007-NBD (VBR V2)
Cliff_Raafs-NRG__Having_Sex_(AKS005)-Vinyl-2007-NBD (VBR V2)
Clive_King_And_Xzellar_-_Evolution_Leaps_Fwd-(SP0404)-Vinyl-2007-HB (VBR V2)
Club_Scene_Investigators_-_Fucking_Society-Promo_Vinyl-2007-QMI (VBR V2)
C-Nex_Feat._infilio_-_rock_this-(2322343-6)-Vinyl-2007-FQS (VBR V2)
C-Nex_Feat_Infilio-Rock_This-Promo_CDM-2007-SND (VBR V2)
Coffeeshock_-_Zenzeo-(TUFF644-12)-Vinyl-2007-HB (VBR V2)
Commercial_Club_Crew_Feat_Cc.K_-_My_Sound-PROPER-Promo-CDM-2007-NBD (VBR V2)
Compression_Vs_Rumbulians-The_Mother_Of_The_Corder-(CHR-622)-Vinyl-2007-OBC (VBR V2)
Coone_-_Bounce_On_Ya_Sneakerz-(DWX-005)-WEB-2007-iHQ (CBR 320 kbps)
Coone_-_The_Chosen_One_(Reverze_Anthem)-(REV-004)-Vinyl-2007-HB (VBR V2)
Coone_-_The_Return_(Remixes)-(TB004)-Vinyl-2007-HB (VBR V2)
Coone_-_Words_From_The_Gang-(REV-008)-Vinyl-2007-HB (VBR V2)
Coone_And_Ghost_-_Pitch_Up-CDS-2007-HB (VBR V2)
Coone_And_Ghost-Pitch_Up_(Incl_Dj_Mystery_Remix)_(YAWA-0750-6)-Vinyl-2007-NBD (VBR V2)
Cosmic_Guys_-_Human_Beings-(DMG049)-Vinyl-2007-NBD (VBR V2)
Cosmic_Guys-I_Like_It_Loud-Ep-Vinyl-2007-GTi (VBR V2)
Cristian_D-Killer_Machine_(KAT048)-Vinyl-2007-NBD (VBR V2)
Crystal-Right_On_The_Way-(PS0010MX)-Vinyl-2007-eMF (VBR V2)
Ctu_-_Hardstyle_Resurrection-Onesided_Bootleg_Vinyl-2007-QMI (VBR V2)
D_And_G_-_House_Of_House-(DWX002)-Vinyl-2007-HB (VBR V2)
D_and_G_-_We_Love_Friday-(ZOO028)-Vinyl-2007-HB (VBR V2)
D_And_G_-_We_Love_Friday-(ZOO028)-WEB-2007-iHQ (CBR 320 kbps)
Da_Emperor_-_Dont_Stop-(RTEK16)-WEB-2007-iHQ (CBR 320 kbps)
Da_Emperor_-_Dont_Stop__Get_Funky-Promo_Vinyl-2007-QMI (VBR V2)
Da_Hustler_-_My_Bass-(RTEK17)-WEB-2007-iHQ (CBR 320 kbps)
Da_Hustler-My_Bass-(RTEK17)-Vinyl-2007-QTXMp3 (VBR V2)
Da_Juve_-_Dinnaken_(Incl_Brainkicker_Remix)_(DJU018)-Vinyl-2007-NBD (VBR V2)
Da_Revolutionists_-_Easy_Girl-(BL10157)-WEB-READ_NFO-2007-Homely (CBR 320 kbps)
Da_Revolutionists_-_How_Much-(BL10158)-WEB-READ_NFO-2007-Homely (CBR 320 kbps)
Da_Revolutionists_-_Postal_(Zatox_Remix)-(BL10156)-WEB-READ_NFO-2007-Homely (CBR 320 kbps)
Da_Revolutionists_-_Postal_EP-Vinyl-2007-QMI (VBR V2)
Da_Tweekaz_-_Angeli_Domini_CDS_Promo-2007-DFM (VBR V0)
Da_X_-_Level_Jump-(RTEK18)-WEB-2007-iHQ (CBR 320 kbps)
Da_X-Level_Jump_(RTEK18)-Vinyl-2007-NBD (VBR V2)
Dana_-_Dont_Fake_The_Funk-(DNMT009)-WEB-2007-HB (CBR 320 kbps)
Dana-Dont_Fake_The_Funk_(DNMT009)-Vinyl-2007-NBD (VBR V2)
Dancefloor_Saints-Carry_on-(DADXCR1909)-Promo_Vinyl-2007-VOiCE (VBR V2)
Daniele_E_Viviana_-_Butterfly-(IMS041)-Vinyl-2007-FMC (VBR V2)
Daniele_E_Viviana_-_Butterfly-WEB-2007-Homely (CBR 320 kbps)
Daniele_Mondello_-_Impact_(IMS040)-Vinyl-2007-NBD (VBR V2)
Daniele_Mondello_-_Somebody_Scream-(SYS-X013)-Vinyl-2007-SQ (VBR V2)
Daniele_Mondello_-_Somebody_Scream-(SYS-X13)-WEB-2007-HB (CBR 320 kbps)
Daniele_Mondello_-_The_Show_Must_Go_On_Ep-Vinyl-2007-QMI (VBR V2)
Daniele_Mondello_Vs_Express_Viviana_Ft_Mc_Tr3no_-_Il_Capo_Di_Tutti_Capi-Vinyl-2007-QMI (VBR V2)
Daniele_Mondello_Vs_Express_Viviana_Ft_Mc_Tr3no_-_Il_Capo_Di_Tutti_Capi-WEB-2007-Homely (CBR 320 kbps)
Danny_Bpm_-_Gottan-(BOMB0704-6)-Vinyl-2007-HB (VBR V2)
Danny_C_And_Ghost_-_Deja_Vu__Damage-(REAKTION12)-Vinyl-2007-HB (VBR V2)
Dany_BPM_-_Gottan__Move_Your_Body-Vinyl-2007-QMI (VBR V2)
Dany_Bpm_-_The_Chaotic_Ep-Vinyl-2007-QMI (VBR V2)
Dark_By_Design_-_Advanced_(DESIGND001)_Onesided_Bootleg-Vinyl-2007-NBD (VBR V2)
Dark_By_Design_-_Crazy__Stigmata-(DBD005)-WEB-2007-eST (CBR 320 kbps)
Dark_By_Design_-_Get_Your_Freak_On-Vinyl-2007-QMI (VBR V2)
Dark_By_Design_-_Money_Shot__Hate-(DBD003)-WEB-2007-eST (CBR 320 kbps)
Dark_By_Design_-_Psycho__S.T.F.u_(DBD004)-Vinyl-2007-NBD (VBR V2)
Dark_By_Design-Collaboration_E.P._2_(DBD005)-Vinyl-2007-NBD (VBR V2)
Dark_by_Design-Collaboration_EP-(DBD003)-Vinyl-2007-MTC (VBR V2)
Dark_By_Design-Mad_World-Vinyl-2007-GTi (VBR V2)
Dark_By_Design-Psycho__STFU-(DBD004)-WEB-2007-UKHx (CBR 320 kbps)
Dark_Oscillators_-_Nero-WEB-2007-SRG (CBR 192 kbps)
Dark_Oscillators_-_Superstar_DJ-Vinyl-2007-QMI (VBR V2)
Dark_Oscillators-Nero-(BLQ050)-WEB-2007-DFM_INT (CBR 320 kbps)
Dark_Oscillators-Superstar_DJ-(BLQ046)-WEB-2007-DFM_INT (CBR 320 kbps)
Dark_Oscillators-Superstar_Dj-WEB-2007-Homely (CBR 192 kbps)
Dark-E_-_Holographic-(ZOO029)-Vinyl-2007-HB (VBR V2)
Dark-E_-_Holographic-(ZOO029)-WEB-2007-iHQ (CBR 320 kbps)
Dark-E_And_Francois_-_Cold_Fever__6AM-(ZINO003)-Vinyl-2007-HB (VBR V2)
Daryl-V_Vs_Jumperz_Spirit_-_The_Beat__Attack-(HRDL008)-Vinyl-2007-HB (VBR V2)
Dave_Dope_-_So_Hard-(TRK006)-WEB-2007-eST (CBR 320 kbps)
Dave-Rik_-_Legend-(KOJ05)-Vinyl-2007-HB (VBR V2)
David_Dtx-Jump_Conspiration-(CHR-619)-Vinyl-2007-OBC (VBR V2)
David_Verbek_-_No_More__Kookai-(KAK015)-Vinyl-2007-iHQ (VBR V2)
David_Verbek_-_Vintage_Spirit-(DB001)-Vinyl-2007-HB (VBR V2)
Davide_Sonar_-_Reactor-(SXIT001)-Vinyl-2007-HB (VBR V2)
Davide_Sonar_-_Reactor__Beatz_4_U-(SXIT001)-WEB-2007-HB_INT (CBR 320 kbps)
Davide_Sonar_-_Reactor__Beatz_4_U-WEB-(READ_NFO)-2007-Homely (CBR 192 kbps)
Davoodi_-_Sacred_Grounds_EP-(ROT005)-Vinyl-2007-HB (VBR V2)
Davoodi_-_Swagger_Jacker_EP-(SW7004)-Vinyl-2007-FMC (VBR V2)
Dazzle-EP-WEB-2007-VeRsAcE (CBR 320 kbps)
D-Block_and_S-Te-Fan_-_Guilty-(NC003)-CDR-2007-iHQ (VBR V2)
D-Block_And_S-Te-Fan_-_Guilty-(NC003)-Promo_CDR-2007-SBS (CBR 320 kbps)
D-Block_And_S-Te-Fan_-_Guilty-(NC003)-Vinyl-2007-HB_INT (VBR V2)
D-Block_And_S-Te-Fan-Guilty-(NC003)-WEB-2007-Homely (CBR 320 kbps)
D-Devils-The_6th_Gate_2007_(2321978-6)_RETAIL-Vinyl-2007-NBD (VBR V2)
D-Devils-The_6th_Gate_2007-CDS-2007-GTi (VBR V2)
Dead_or_Alive_and_Kernkraft_400_-_You_Spin_Me_Round_and_Zombie_Nation_Remixes-Vinyl-2007-EDF (VBR V2)
Deejay_Rich_Hard_And_Dj_Flapa_-_Xpansion_Melody-(BU-0012-MX)-Vinyl-2007-MS (VBR V2)
Deepack_-_Speakerfreakz_Anthem__Drop_Out-Vinyl-2007-QMI (VBR V2)
Deepack_-_Speakerfreaxz-(HC003)-WEB-2007-HB (CBR 320 kbps)
Deepack_-_Tha_Roof_Iz_On_Fire-(HC007)-WEB-2007-HB_INT (CBR 320 kbps)
Deepack_-_Tha_Roof_Iz_On_Fire-(HC007CDS)-CDS-2007-HB (VBR V2)
Deepack_and_Charly_Lownoise_-_Decibel_Habits-(HC006)-WEB-2007-XTC_Only (ABR)
Deepack_And_Charly_Lownoise_Featuring_MC_Villain-Cant_Hold_Us_Down_(HC006)-Vinyl-2007-NBD (VBR V2)
Deepack_and_Charly_Lownoise_Ft._MC_Villain_-_Decibel_Habits-(HC006)-WEB-2007-HB (CBR 320 kbps)
Defekt_and_Andy_B_-_Dance_Now-(TREM021)-WEB-2007-iHQ (CBR 320 kbps)
defqon_one_2007_-_brennan_heart-WEB-16-06-2007-iND (CBR 128 kbps)
Delta_vs_DJ_Dex_-_Blender_Sandwich_EP-(T1025)-Vinyl-2007-iMC (VBR V2)
Delta_vs_DJ_Dex_-_C-Bird_Remixes-(T1027)-WEB-2007-SOB (VBR V2)
Delysid-25_-_Planned_Intent__Tabu-(FLMLTD_D)-Promo_Vinyl-2007-HQEM (VBR V2)
Demons_On_Dope_-_Die_Die_Die-(WEB)-2007-ATRium (CBR 320 kbps)
Devano_-_Dance_To_My_Beat-(ZIN004)-Vinyl-2007-HB_INT (VBR V2)
Devano_and_DJ_Francois_-_Dance_(To_My_Beat)_Phatt_Shitt_(ZINO004)-Vinyl-2007-KTB (VBR V2)
Devano-Crazy_World-Vinyl-2007-MTC (VBR V2)
Dhhd_-_On_Fire-(MYTH007)-Proper-Vinyl-2007-HB (VBR V2)
Dhhd_-_On_Fire_(MYTH007)-Vinyl-2007-KTB (VBR V2)
Di_Face_Feat._Kaz_-_Let_Your_Love-(D10MX010)-WEB-2007-NRG (VBR V0)
Diex-Sounds_Like_Rave-(NRT012)-Vinyl-2007-hM (VBR V2)
Digimind_-_Paranoia__Remixes-Vinyl-2007-QMI (VBR V2)
Digital_Punk_-_The_Punk_Soul_Brother-(TREM017)-WEB-2007-iHQ (CBR 320 kbps)
Dinamik_-_Punk_That__No_Break-(WA026)-Vinyl-2007-HB (VBR V2)
Dirk-Jan_DJ_-_Pak_Een_Punt-(SCANTRAXXL004)-WEB-2007-SOB (CBR 320 kbps)
Dirk-Jan_DJ-Pak_Een_Punt-(SCANTRAXXL004)-Promo_Vinyl-2007-HDF (VBR V2)
Dizmaster_-_Intoxicated-(EH03)-Vinyl-2007-HB (VBR V2)
Dj_Act_Vs_Dj_Mani-Il_Mondo_E_Mio-Vinyl-2007-SND (VBR V2)
Dj_Activator_-_Icon-(ACTSE001)-Onesided_Vinyl-2007-HB (VBR V2)
Dj_Activator_-_Im_A_Natural_Born_Dj-(ACT070)-Promo_CDR-2007-iHQ (VBR V2)
DJ_Activator_-_Im_A_Natural_Born_DJ-(ACT070)-Vinyl-2007-HB_INT (VBR V2)
Dj_Activator__Mc_Syco__Mc_Da_Syndrome_Present-2_Mcs_And_1_Dj_(ACT073)-Vinyl-2007-NBD (VBR V2)
Dj_Activator-Calling_In_The_Night__Im_Gonna_Diss_You_Right_Now-(ACT075)-WEB-2007-gnvr (CBR 320 kbps)
Dj_Activator-Calling_In_The_Night-Vinyl-2007-SND (VBR V2)
Dj_Adk_Feat_Linda_-_You_Came__Incl_Vorwerk_Remix-Vinyl-2007-QMI (VBR V2)
Dj_Auza-Mentira-(ACT005)-WEB-2007-MK2 (CBR 320 kbps)
Dj_Bam_Bam_-_Base_Banging_The_Remixes-(JKS012)-Vinyl-2007-NBD (VBR V2)
Dj_Bam_Bam_Feat._alex_peace_-_bams_workout_(the_remixes)-(BHM014)-WEB-2007-FQS (VBR V2)
DJ_Basik_-_Basik_Beats_2-Vinyl-2007-KTB (VBR V2)
Dj_Basik_-_Basik_Beats_3-(TB005)-Vinyl-2007-KTMP3 (VBR V2)
DJ_Basik_-_Basik_Beats_II-(ZOO027)-Vinyl-2007-HB (VBR V2)
Dj_Basik_-_Basik_Beats_Ii-(ZOO027)-WEB-2007-iHQ (CBR 320 kbps)
DJ_Basik_-_Basikology-(ZOO021)-2xVinyl-2007-HB (VBR V2)
Dj_Ben_and_Rafa_Urbano_-_Free_Me_(OVERBOOKING020)-Vinyl-2007-NRG (VBR V2)
DJ_Berry_Morgana_-_Fingerfucked-Vinyl-2007-QMI (VBR V2)
Dj_B-Front_-_My_Style_Ep-(DJS018)-Vinyl-2007-HB (VBR V2)
Dj_Brush_-_What_Ep-Vinyl-2007-QMI (VBR V2)
Dj_Caesar_9114_-_Alea_Jacta_Est_(72-721)-Vinyl-2007-NRG (VBR V2)
DJ_Chus_And_David_Penn-We_Play_House__Incl_Remixes-(CABA015)-WEB-2007-MPX (CBR 320 kbps)
Dj_Contra_-_Different_World-(EX-0013-MX)-PROPER-Vinyl-2007-NRG (VBR V2)
Dj_Coone_-_Bounce_On_Ya_Sneakerz-(DWX005)-Vinyl-2007-HB (VBR V2)
DJ_Dani_-_Never_Die-(EX-0009-MX)-Vinyl-2007-NRG (VBR V2)
DJ_Dean_-_Club_Analysis_EP-Vinyl-2007-QMI (VBR V2)
DJ_Dean_-_Dreamworld-Vinyl-2007-QMI (VBR V2)
DJ_Dean_Pres_Van_Nilson_-_Euphoria-Vinyl-2007-QMI (VBR V2)
DJ_Digress_-_Extreme_Elektroshock-Vinyl-2007-QMI (VBR V2)
Dj_Dipropy_-_Inmortal_(72-722)-Vinyl-2007-NRG (VBR V2)
DJ_Dopping_And_DJ_Dekor_-_Attenzione-(BIT72-708)-Vinyl-2007-FMC (VBR V2)
Dj_Dragan_Vs_Luke_Spellbound_-_Gateway_2_Hell-(DJS017)-Promo_Vinyl-2007-HB (VBR V2)
DJ_E-Maxx-Make_U_Move-Promo-CDM-2007-ZzZz (VBR V2)
Dj_Enigma-Kmon_Moving-(RED027)-WEB-2007-MK2 (CBR 320 kbps)
DJ_Entity_and_CLSM-The_Curry_House_EP-KTK009-Vinyl-2007-XTC (VBR V2)
Dj_Erik_2k_-_On_The_Move__Incl_Dj_Yoeri_Remix-Vinyl-2007-QMI (VBR V2)
DJ_Extreme_-_Sixth_Sense_E.P._(KAT041)-Vinyl-2007-NBD (VBR V2)
Dj_Faby_-_Blow_Your_Brains_(CHR604)-Vinyl-2007-NRG (VBR V2)
DJ_Fait_-_Shining_Star__Incl_Mike_Nero_Jumpstyle_Mix-Vinyl-2007-QMI (VBR V2)
DJ_Frantz_-_Jump_Masterz-Vinyl-2007-QMI (VBR V2)
Dj_Frenetic_-_Frenetic-Ep-(KAT045)-Vinyl-2007-NBD (VBR V2)
DJ_Furax_-_Body_Hard-Vinyl-2007-QMI (VBR V2)
Dj_Furax_And_V-Beatz_-_Kobalt__Incl_Pat_B_Remix-Vinyl-2007-QMI (VBR V2)
Dj_Furax-Sambali_(FFF001)-Vinyl-2007-NBD (VBR V2)
Dj_Gave_-_Let_Me_Show_You_Ep-(KOZ001)-Proper-Vinyl-2007-HB (VBR V2)
Dj_Gave_-_Let_Me_Show_You_Ep-Vinyl-2007-QMI (VBR V2)
Dj_Genius_-_Pureness-(TREM018)-WEB-2007-iHQ (CBR 320 kbps)
Dj_Genius_-_Pureness-Vinyl-2007-QMI (VBR V2)
DJ_Gio_-_Lucky_No_Thirteen-(POPE1005)-Vinyl-2007-HB (VBR V2)
DJ_Gius_-_Definition_Of_A_Track-(POLL257)-WEB-2007-SOB (CBR 320 kbps)
DJ_Gius_-_Scrubs-(BLQ048)-CDR-2007-iHQ (VBR V2)
Dj_Gius-Scrubs-(BLQ048)-WEB-2007-DFM (CBR 320 kbps)
DJ_Gius-Things_To_Do-(BLQ045)-Promo_Vinyl-2007-UNiT (VBR V2)
Dj_Gius-Things_To_Do-(BLQ045)-WEB-2007-DFM (CBR 320 kbps)
Dj_Gizmo_And_Symastic_-_Pump_Up_The_Bass-(GIZM002)-WEB-2007-XDS (CBR 320 kbps)
DJ_Gordy_-_Kiss_Impact-(AD0105MX)-Vinyl-2007-MS (CBR 192 kbps)
DJ_Greenie-You_Treat_Me_Right-Vinyl-2007-SDS (VBR V2)
DJ_Greg_C_-_Lets_Try_Again-(BABA078)-Vinyl-2007-HB (VBR V2)
Dj_Guenot_-_Magnum__What_A_Feeling-(KAK018)-Vinyl-2007-HB (VBR V2)
DJ_Harmp3-Zirtaki_Jump-CDS-2007-DOH (VBR V2)
DJ_Hellstorm_-_Love_2night-(NMG061)-WEB-2007-eST (CBR 320 kbps)
DJ_HS_And_Divinna_-_Ive_Got_Your_Pleasure__Fetish_Power-(KAK020)-Vinyl-2007-LiR (VBR V2)
DJ_Isaac_-_Face_Down_Ass_Up-(JUMIT003)-Vinyl-2007-HB (VBR V2)
Dj_Isaac_-_Impressed-(XRATE009)-Vinyl-2007-HB (VBR V2)
DJ_Isaac_-_Impressed-(XRATE009)-WEB-2007-HB (CBR 320 kbps)
DJ_Isaac_-_Impressed-WEB-2007-SRG_INT (CBR 320 kbps)
DJ_Isaac_-_Waiting_For__Bad_Dreams_2007-Vinyl-2007-QMI (VBR V2)
DJ_Jajo_-_I_Have_A_Dream-(HTL07.01)-Vinyl-2007-FMC (VBR V2)
Dj_Javi_Colas-Feel_The_Newstyle-(CHR-621)-Vinyl-2007-OBC (VBR V2)
DJ_Jerome_vs_Gerrit_-_Clap_And_Jump-CDS-2007-HB (VBR V2)
DJ_Joey-GZ_Anthems-(PROMO)-2007-TRa (VBR V2)
DJ_Joshua_Hiroshy_Vs._DJ_Millo_-_Frisko_Disko__Rock_This_(DFC1512)-Vinyl-2007-NBD (VBR V2)
DJ_Juan_Martinez_Presents._Rakel-I_Gave_You_My_Life-(PLAMIX005)-Vinyl-2007-OBC (VBR V2)
Dj_Junkinx-Playa_Haters_Ep-(GNR-001)-Vinyl-2007-OBC (VBR V2)
DJ_Kanta_Vs_DJ_Guty-The_A_Poky-(DC187)-Vinyl-2007-eMF (VBR V2)
DJ_Kbo-Break_Down_(ACT-002)-Vinyl-2007-NRG (VBR V2)
DJ_Kicken_-_Louder_(OEH_OEH)-CDS-2007-HB (VBR V2)
DJ_Kubrik_-_Shiny_2007-(ATH124)-Vinyl-2007-QMI (VBR V2)
DJ_L.E.D.-Jump_Around_(DEL012)_Onesided_Bootleg-Vinyl-2007-NBD (VBR V2)
DJ_LB_-_The_Pink_Panther-Vinyl-2007-QMI (VBR V2)
Dj_Main-Another_World_(DJS019)-Vinyl-2007-NBD (VBR V2)
Dj_Malry-Battle_1-(RED026)-WEB-2007-MK2 (CBR 320 kbps)
Dj_Maniak_-_Electric_Psycho_(CHR-615)-Vinyl-2007-NRG (VBR V2)
DJ_Manu_A_Vs_Chiki_DJ_Feat_Irene-Please_Dont_Say-(CON546EP)-Vinyl-2007-eMF (VBR V2)
DJ_Manu_A-Fly_Into_The_Sky-Promo_Vinyl-2007-eMF (VBR V2)
Dj_Marcky_-_Enemy_Of_The_State__At_Work-(JF20)-Vinyl-2007-HB (VBR V2)
Dj_Mass_Feat_Dj_Dets_-_Say_Goodbye-(ADJ008-12)-Vinyl-2007-HB (VBR V2)
DJ_Massiv_vs_Steve_Dexter_-_Flashback__Da_Underground-(JP9086)-REPACK-Onesided_Vinyl-2007-HB (VBR V2)
Dj_Massiv_Vs_Steve_Dexter_-_Flashback__Da_Underground-(JP9086)-Vinyl-2007-HB (VBR V2)
DJ_Massiv_vs_the_Rebel_-_Back_in_Time-(JP9082)-Vinyl-2007-HB (VBR V2)
Dj_Massiv_Vs_The_Rebel_-_The_Album-(JP9080)-3xVinyl-2007-HB (VBR V2)
Dj_Mikesh_-_2_Know_Good__Kolumbien__Incl_Maziano_Remix-Vinyl-2007-QMI (VBR V2)
Dj_Millo_-_Hardtraxx_Vol._2-(DFC1510)-WEB-2007-iHQ (CBR 320 kbps)
DJ_Mortadelo-Da_Bassklubbers-(PLAMIX008)-Vinyl-2007-eMF (VBR V2)
DJ_Mystery_-_Spring_Break__Its_My_B.O.M.B.-Vinyl-2007-QMI (VBR V2)
Dj_N3ck_And_Decepticon_Present_Melodyne-Ultraviolence_(EXP050)-Vinyl-2007-NBD (VBR V2)
DJ_N3ck_Decepticon_Presents_Melodyne_-_Ultraviolence-(EXP050)-WEB-2007-HB (CBR 320 kbps)
Dj_Napo_And_Alex_Trackone-Just_Tell_Me_How-(NUB002)-Vinyl-2007-OBC (VBR V2)
DJ_Napo_Presenta_Radical_Vol._5-Anymore-(NUB003)-PROPER-Vinyl-2007-eMF (VBR V2)
Dj_Native-2_The_Beatz_(BAZP003)-Vinyl-2007-NBD (VBR V2)
DJ_Nemesis_Ft_Lisa_Abbott-Spy_U_Spy-WEB-2007-UKHx (CBR 320 kbps)
Dj_Neo_-_Funky__In_My_Mind-(BLU120)-WEB-2007-eST (CBR 320 kbps)
Dj_Noizer_And_Dj_Berry_Morgana_-_We_Rockin-(DJ007)-Vinyl-2007-HB (VBR V2)
Dj_Norman_And_Dcarrera_Ft._mc_da_syndrome-crazy_on_the_dancefloor_(MYTHW001)-Vinyl-2007-NBD (VBR V2)
Dj_Norman_And_Tha_Bomb_Aka_Dj_Mystery-Turn_It_Up__Trancebass_(BOMB0701-6)-Vinyl-2007-NBD (VBR V2)
Dj_Ogalla_-_Leire_(CHR-608)-Vinyl-2007-NRG (VBR V2)
DJ_Pablo_Saez-Agresiva_(CHR620)-Vinyl-2007-NRG (VBR V2)
Dj_Pat_B_-_Love_Of_My_Live-(ER00023)-Vinyl-2007-HB (VBR V2)
DJ_Pat_B_-_Make_Your_Own_Kind_Of_Music-Vinyl-2007-QMI (VBR V2)
Dj_Pat_B_-_P.H.U.N.K.-(JF21)-Vinyl-2007-HB (VBR V2)
dj_piju_and_dj_pok_-_lose_myself_(BU-0014-MX)-Vinyl-2007-nrg (VBR V2)
DJ_Piju_and_DJ_Pok_-_Tutti_Fruti_EP_Vol_3-(BU-0011-MX)-Vinyl-2007-MS (VBR V2)
Dj_Poogie_And_Dj_Tronic_-_Thirteen-Vinyl-2007-QMI (VBR V2)
DJ_Porny-Me_So_Horny-(CDM)-2007-EGM (VBR V2)
DJ_Porny-Porny_People-CD-2007-DOC (VBR V2)
DJ_Porny-Still_Horny-CDS-REPACK-2007-DOH (VBR V2)
DJ_Pumpy_Presents_Luz_Tukru_-_Carnaval_De_Paris-(UN017)-Vinyl-2007-HB (VBR V2)
DJ_Raboen_-_Twisted-Vinyl-2007-QMI (VBR V2)
Dj_Rase-Wake_Up-(FK009MX)-Vinyl-2007-OBC (VBR V2)
DJ_Raul_Soto-The_Top-(AR06)-Vinyl-2007-eMF (VBR V2)
Dj_Rave_Vs_Dj_Traxx-Bionik_Sound-(RED025)-Vinyl-2007-OBC (VBR V2)
DJ_Resound-Restless-(CDS)-2007-MTD (VBR V2)
DJ_Rob_And_MC_Joe-The_Beat_Is_Flown_2007_(TREM020)-Vinyl-2007-NBD (VBR V2)
DJ_Ruthless_Vs_GJ_Warez_-_Movimento-(SQUARE016)-Vinyl-2007-HB (VBR V2)
DJ_RX_-_Hellfire-(FINRGHARD005)-Vinyl-2007-FMC (VBR V2)
Dj_Sacrifice-Whats_My_Name-(72-787)-WEB-2007-MK2 (CBR 320 kbps)
Dj_Sagy_-_Da_Jump_(CHR603)-Vinyl-2007-NRG (VBR V2)
DJ_Seb_B_-_Scarnation-(WA024)-Vinyl-2007-JEF (VBR V0)
DJ_Seb_B_Present_Setback_-_Scarnation-Vinyl-2007-QMI (VBR V2)
DJ_Seduction_-_50000_Watts-(MAXIMP031)-Vinyl-2007-JiM (VBR V2)
DJ_Skep_-_I_Dont_Give_A_Fuck_EP-(SR001)-Vinyl-2007-HB (VBR V2)
Dj_Snowstorm_-_Soul_(STK128)-Vinyl-2007-NBD (VBR V2)
DJ_Stone_-_Hear_Me_EP-(JP9088)-Vinyl-2007-HB (VBR V2)
DJ_Stone_-_Off_Balance_EP-Vinyl-2007-QMI (VBR V2)
Dj_Syro_-_Shocked_Phuture-(PIBL-004)-Vinyl-2007-HB (VBR V2)
Dj_Syro_-_Shocked_Phuture__No_More_Hardtraxx_(PIBL004)-WEB-2007-gnvr (CBR 320 kbps)
DJ_Syro_-_The_Bazz_Keeps_Pumpin__Incl_Kayem_Remix-Vinyl-2007-QMI (VBR V2)
Dj_Syro_-_Whorezz__Incl_Equal_Mindz_Remix-Promo_Vinyl-2007-QMI (VBR V2)
DJ_Syro_Presents_Technotexx_vs_Da_Hollow_-_Jump_To_It-(JUMPIT001)-Vinyl-2007-HB (VBR V2)
Dj_Syro-The_Bazz_Keeps_Pumpin-WEB-2007-Homely (VBR V2)
Dj_Therapia_Presents_Savage_C_-_Vibes_It_Up__Lspx-(CLABLA002)-WEB-2007-FQS (VBR V2)
Dj_Thomas_Vs_DJ_Tronic_Feat._Sacrifice_-_Project_AM_(NEW049MX)-Vinyl-2007-NRG (VBR V2)
Dj_Toff_-_La_Playa-(KAK016)-Vinyl-2007-HB (VBR V2)
DJ_Tom-809_-_Mars_Attack_2007-(SUB223)-Vinyl-2007-FMC (VBR V2)
Dj_Tony_-_The_Unknown__Scrap-(SPK022-5)-Vinyl-2007-HB (VBR V2)
Dj_Tony-The_Unknown__Scrap-(SPK022-5)-WEB-2007-DFM (CBR 320 kbps)
Dj_Tronic_-_The_Audio_Hijack_Project-(0000001)-Vinyl-2007-HB (VBR V2)
DJ_Vicen_Vol_1-Apany-(ACT-004)-WEB-2007-MK2 (CBR 320 kbps)
Dj_Vinnie_V_-_Bitch-(EM003)-WEB-2007-eST (CBR 320 kbps)
Dj_Vortex_-_Come_On_And_Fight_2007_Reworks-(STK133)-READ_NFO-Vinyl-2007-HB (VBR V2)
Dj_Vortex_Vs._alex_plasma_-_my_style_(STK131)-Vinyl-2007-NBD (VBR V2)
Dj_W4cko_And_Casaya_-_Endless_Desires-(TSR005)-Vinyl-2007-HB (VBR V2)
DJ_Yanny_-_Rhythm_Is_A_Bass__Part_2-(TR3130)-Vinyl-2007-FMC (VBR V2)
DJ_Yanny_-_Rhythm_Is_A_Dancer-Promo_Vinyl-2007-QMI (VBR V2)
Dj_Yoeri-Jumpstyle_Shit__Fuck_On_Cocaine_2007-CDS-2007-GTi (VBR V2)
Dj_Yorit_-_First_Rebirth-CDS-2007-HB (VBR V2)
DJ_Yorit-Welcome_To_My_World-CDS-2007-DOH (VBR V2)
Dj_Youri_-_Jumpstyle_Shit-WEB-2007-Hlsmp3 (CBR 256 kbps)
Dj_Yves_Presents_Club_X_-_Bloodbrain_2007-Vinyl-2007-QMI (VBR V2)
Dj_Zaap_-_The_Stuff_Of_Darkside_Hardstyle_Remix_Singel_2007-T4ll1 (CBR 192 kbps)
DJ_Zany_-_Volt__Inflator-Vinyl-2007-QMI (VBR V2)
Dj_Zany-Back_Again_-_Hasta_La_Pasta-WEB-2007-Homely (VBR V2)
Dj_Zany-Volt__Inflator-Promo_CDS-2007-TWCMP3 (VBR V2)
Djanny_-_Rock_The_Beat__Limonada-Vinyl-2007-QMI (VBR V2)
Djs_United-Everytime_You_Touch_Me-(MAXIMP034)-Promo_Vinyl-REPACK-2007-UKHx (VBR V2)
D-Noizer_Aka_Ronald-V_-_Anthology_Works_Revisited-(RM-068)-Vinyl-2007-HB (VBR V2)
D-Noizer_Aka_Ronald-V_-_Go_On_Move__Incl_Binum_Remix-Vinyl-2007-QMI (VBR V2)
Dogmatic_Angels-Searchlight_E.P._(LTE01)-Vinyl-2007-NBD (VBR V2)
Donkey_Rollers_-_Atrocity__Chopper-(FUSION040-5)-WEB-2007-iHQ (CBR 320 kbps)
Donkey_Rollers_-_Atrocity__Chopper_(FUSION_040-5)-PROPER_Vinyl-2007-DFM (CBR 320 kbps)
Donkey_Rollers_-_Atrocity__Chopper-Vinyl-2007-QMI (VBR V2)
Donkey_Rollers_-_The_Fusion_Of_Sound_(FUSION036-5)-WEB-2007-DFM (CBR 320 kbps)
Donkey_Rollers_-_The_Fusion_Of_Sound-Vinyl-2007-QMI (VBR V2)
Donkey_Rollers-The_Fusion_Of_Sound-(FUSION_036-5)-READ_NFO-Vinyl-2007-HDF_INT (VBR V2)
Double_Dutch_-_Back_2_Your_Love-(BB071)-Promo_Vinyl-2007-JiM (VBR V2)
Dr_Bass_Vs_Hyghpass_-_Mega_Open_Air_Ep-(23-22146-6)-Vinyl-2007-HB (VBR V2)
Dr_Luv_-_Do_It_Again-Vinyl-2007-QMI (VBR V2)
Dr_Madness-Army_Duck-(LMB000001)-Vinyl-2007-OBC (VBR V2)
Dr_Rude_-_Voodoo_Beats_EP-Vinyl-2007-QMI (VBR V2)
Drunkenmunky_-_Calabria_(2007_JUMP_MIX)-CDS-2007-HB (VBR V2)
Dutch_Master_-_Resort_To_The_Beat__Killer_Beat-(DMW021)-Vinyl-2007-HB (VBR V2)
Dutch_Master_-_Resort_To_The_Beat_-_Killer_Beat_(DMW021)-Proper-Vinyl-2007-Jolf (CBR 320 kbps)
Dutch_Master_-_Resort_To_The_Beat__Killer_Beat_(DMW021)-WEB-2007-gnvr (CBR 320 kbps)
Dutch_Master_-_Slammin_The_Bazz__We_Go_Party-(DMW016)-WEB-2007-HB (CBR 320 kbps)
Dutch_Master_-_Slammin_The_Bazz__We_Go_Party-Vinyl-2007-QMI (VBR V2)
Dutch_Master-Slammin_The_Bazz__We_Go_Party-(DMW016)-WEB-2007-SSK (CBR 320 kbps)


E-Fect-A_New_Saga-Vinyl-2007-SND (VBR V9)
Ekeaze_Vs_Dave_LXR-Angel_Trip-(PIRATUNIT02)-Vinyl-2007-hM (VBR V2)
El_Grekoz_-_Another_Kind_Of_Music__What_Women_Want-WEB-2007-DFM (VBR V1)
El_Grekoz_-_Lovesong-WEB-2007-Homely (CBR 320 kbps)
El_Grekoz-Lovesong__The_Day_Of_The_End_(BTE007)-Vinyl-2007-NBD (VBR V2)
Electrostan_-_Electrostanik-(KOJ06)-Vinyl-2007-HB (VBR V2)
Electrostan_-_Flashback__Nightmare-(KOJ02)-Vinyl-2007-HB (VBR V2)
E-Max_And_Dp_Ft_Gave_-_All_U_Hoz-(ETRAXX001)-READ_NFO-Vinyl-2007-HB (VBR V2)
E-More_Vs_Andy_Zeta_And_Tommy_R_-_In_the_Shadow-(BTE012)-Vinyl-2007-HB (VBR V2)
Enders_Aka_Lobotomy_And_Dinamik_-_Back_In_Hard-(ST001)-Vinyl-2007-HB (VBR V2)
Enok_Itoz_-_Kindly_And_Gently-Vinyl-2007-QMI (VBR V2)
Epyx_and_Cyrez-Fragile_Mind-FINRG19-WEB-2007-XTC (CBR 320 kbps)
Equal_Mindz_-_Hardminded-Vinyl-2007-QMI (VBR V2)
Eretisaw_-_Kamalloh_Ep-(BXX26)-Vinyl-2007-FMC (VBR V2)
Erik_T_-_This_Motherfucking_World_EP_(BTE006)-Vinyl-2007-NBD (VBR V2)
Erik_T_-_To_Rememba_EP-Vinyl-2007-QMI (VBR V2)
Esteban_Lovax_-_Melody_For_Of_Peace-(HRDL006)-Vinyl-2007-HB (VBR V2)
Etnuz_-_Already_Damned-(HBHARDSTYLE005)-WEB-2007-eST (CBR 320 kbps)
Etnuz_-_Nevrosi_Beat-(HB003)-WEB-2007-iHQ (CBR 320 kbps)
Euphoria_-_Better_Than_Before-(NG071)-Promo_Vinyl-2007-JiM (VBR V2)
Euphoria_-_Restore_My_Heart-(BB075)-Vinyl-2007-JiM (VBR V2)
Evil_Z_-_The_End_Of_Time_(Cyber_Raver_Anthem)-(EXP047)-WEB-2007-HB (CBR 320 kbps)
Evil_Z-End_Of_Time-Vinyl-2007-SND (VBR V2)
Express_Viviana_-_Oh_My_God_Ep-Vinyl-2007-QMI (VBR V2)
Fausto_And_Tommy_Pulse-Poison_(STIND012)-Vinyl-2007-NBD (VBR V2)
Felix_Project_-_Soviet_Song-(TUFF643-12)-Vinyl-2007-HB (VBR V2)
Felix_Project_-_Soviet_Song__Lonely-CDS-2007-HB (VBR V2)
Fliegenpilz_-_No_Rules_E.P._(KT059)-Vinyl-2007-NBD (VBR V2)
Foot_Soldiers_-_Jump-Vinyl-2007-QMI (VBR V2)
Foot_Soldiers-Jump-(CDM)-2007-NBNL (VBR V2)
For_A_Jumper_-_For_An_Angel-(23-22313-6)-Vinyl-2007-HB (VBR V2)
For_A_Jumper-For_An_Angel__Greece_2000-CDS-2007-GTi (VBR V2)
fosforic_-_give_it_hard-(SJ008)-Vinyl-2007-hb (VBR V2)
Fosforic_-_The_Underground-(SJ010)-Vinyl-2007-HB (VBR V2)
Frances_Dj-Misilman-(FHR-002-MX)-Vinyl-2007-OBC (VBR V2)
Frances_Dj-Pitsha-(72760)-Vinyl-2007-OBC (VBR V2)
Francesco_Zeta_And_Brucio_Dj_-_Rising_Ep-(KAT044)-Repack-Vinyl-2007-HB (VBR V2)
Francesco_Zeta_And_Brucio_Dj_-_Rising_Ep-(KAT044)-Vinyl-2007-HB (VBR V2)
Francois_And_Laurent_-_Bells_From_Nowhere-(BTB003)-Vinyl-2007-FMC (VBR V2)
Franky_Dux_-_The_Meeting-Vinyl-2007-QMI (VBR V2)
Frantic_Vs_Impact_and_Resist_-_Spending_My_Time-(CLANS002)-Promo_Vinyl-2007-SQ (VBR V2)
Frisky_and_Hujib_-_Get_Away-(NG068)-Promo_Vinyl-2007-JiM (VBR V2)
Furax_And_V-Beatz_-_Violon_De_La_Nuit-CDS-2007-QMI (VBR V2)
Future_Vision_-_Your_Love-(VTX006)-WEB-2007-HB (CBR 320 kbps)
Gary_D_-_Hardstylebass-Vinyl-2007-QMI (VBR V2)
Gary_D_Meetz_B-Shock_-_Good_Shit-(D.TRAXX-001)-Vinyl-2007-HB (VBR V2)
Gee_and_Dee_-_Oops__Funk_Off-(TTJ005)-Vinyl-2007-JiM (VBR V2)
Genius_Jumpers-Whats_That_Sound-CDS-2007-DOH (VBR V2)
Ghost_-_My_Sensation_Is_Black-(SENSATION_BELGIUM)-Promo_CDS-2007-HB (VBR V2)
Gigi_Pussy-Cartulis-(GGP006)-Vinyl-2007-eMF (VBR V2)
Gio_Benoni_-_Morceau_Terrible-(DSLP1001)-Vinyl-2007-HB (VBR V2)
Girls_From_Hardasia_-_A_Little_Beat_More-(GEE091)-WEB-2007-eST (CBR 320 kbps)
Girls_From_Hardasia_-_Hardasia_(GEE087)-Vinyl-2007-NBD (VBR V2)
GJ_Warez_-_Aircraft-(SQUARE015)-Vinyl-2007-HB (VBR V2)
Glowiej_Meets_The_Profilerz_-_Aight_(DTX006)-Vinyl-2007-NBD (VBR V2)
Gollum_And_Yanny_-_Delirio_Mind_2k7-Vinyl-2007-QMI (VBR V2)
Grady_G-Seizure__Firefox_Remix-(PFILTH002)-WEB-2007-Homely (CBR 320 kbps)
Grandmaster_Q_-_The_7th_Sign-(HC005)-READ_NFO-WEB-2007-HB (CBR 320 kbps)
Grandmaster_Q_-_The_7th_Sign-(HC005)-WEB-2007-Homely (CBR 192 kbps)
Grandmaster_Q-The_7th_Sign__Something_To_Party-Vinyl-2007-SND (VBR V2)
Greg_Notill_and_Dariush_Gee_-_France__Poland-(ATW03)-Vinyl-2007-FMC (VBR V2)
Groucho_Gang_-_Automatic_Traxx_(GRC065)-Vinyl-2007-NBD (VBR V2)
Gt_Werk_-_Censure_Remix-Vinyl-2007-QMI (VBR V2)
GVA_Vs_Inner_State_-_We_Have_Raped_Eric-Onesided_Vinyl-2007-QMI (VBR V2)
Gwen_Stefani_-_Wind_It_Up__Hardstyle_Remix-Onesided_Bootleg_Vinyl-2007-QMI (VBR V2)
Ham_-_Dancefloor_Is_Open-(NG073)-Promo_Vinyl-2007-JiM (VBR V2)
Ham_-_Every_Day_Of_My_Life-(BB072)-Promo_Vinyl-2007-JiM (VBR V2)
Hard_Onez-World_Domination-Vinyl-2007-SND (VBR V2)
Hardonez_-_World_Domination-(EXP052)-WEB-2007-HB (CBR 320 kbps)
Hardstyle_Kid-Brain_Trauma-WEB-2007-UKHx (CBR 320 kbps)
Hardstyle_Mafia_-_Rockin_Da_Place__Go_Insane-Vinyl-2007-QMI (VBR V2)
Hardstyle_Mafia-Rockin_Da_Place__Go_Insane-WEB-2007-Homely (CBR 320 kbps)
Hardstyle_Masterz_-_Titanic_Remix_Collection_Vol_4_(Part_1)-(TTC035)-WEB-2007-JiM (CBR 320 kbps)
Hardstyle_Masterz_-_Titanic_Remix_Collection_Volume_4-Vinyl-2007-QMI (VBR V2)
Hardstyle_Masterz_feat._Max_Enforcer_-_Light_Of_The_Dark-(TTC040)-Vinyl-2007-JiM_INT (VBR V2)
Hardstyle_Masterz_Feat_Max_Enforcer_-_Light_Of_The_Dark-(TTC040)-WEB-2007-iHQ (CBR 192 kbps)
Haze_-_Black_Magic__Incl_Brian_NRG_Remix-(BELT013)-Vinyl-2007-HB (VBR V2)
HDJ-Eh_Loco_(ACT-008)-Vinyl-2007-NRG (VBR V2)
Headfucker_-_The_Law-Vinyl-2007-QMI (VBR V2)
Headhunterz_-_Forever_Az_One-(SCREL006)-Vinyl-2007-HB (VBR V2)
Headhunterz_-_Forever_Az_One__Digiwave_(SCREL006)-WEB-2007-gnvr (CBR 192 kbps)
Headhunterz_-_Rock_Civilization-(SCREL004)-WEB-2007-iHQ (CBR 320 kbps)
Headhunterz_-_Rock_Civilization_(SCREL004)-Vinyl-2007-NBD (VBR V2)
Headhunterz_-_The_Power_Of_The_Mind-(Q037)-READ_NFO-Vinyl-2007-HB_INT (VBR V2)
Headhunterz_-_The_Power_Of_The_Mind_(Qlimax_Anthem_2007)-(Q037)-Vinyl-2007-JiM (VBR V2)
Headhunterz_-_The_Power_Of_The_Mind_(Qlimax_Anthem_2007)_(Q037)-WEB-2007-gvnr (CBR 320 kbps)
Headhunterz_Vs._abject_-_scantraxx_rootz-READ_NFO-WEB-2007-Homely (CBR 320 kbps)
Heavyhands_-_Let_It_Be-(GEE089)-WEB-2007-iHQ (CBR 320 kbps)
Hino_and_DJ_Dalton_-_Reson_Dancers_Vol.1_(72704)-Vinyl-2007-NRG (VBR V2)
Huener_And_Ellesmere_-_Returning-(3120-001)-Vinyl-2007-HQEM (VBR V2)
Human_Resource_Vs_Pitch_-_Prepare_For_Glory-TRACKFIX_Vinyl-2007-QMI (VBR V2)
Hunter-I_Shot_The_Blender-(8032484018433)-WEB-2007-Loyalty (CBR 320 kbps)
Hybrid_Theory_-_Ambition-(BABA079)-Vinyl-2007-LiR (VBR V2)
Illegal_Beatz_-_Madafakaz-(72-761)-Vinyl-2007-NRG (VBR V2)
Innasekt-Structure-(SPRENGSTOFF14)-Vinyl-2007-DEF (VBR V2)
Insane_Project_Vs_Di_Face-Core_Connection-(CHR-606)-Vinyl-2007-OBC (VBR V2)
Invader-Enraptured_Soulz_(LUNA-C_REMIX)-EMAG002-Vinyl-2007-XTC (VBR V2)
Italian_Playboys_-_Storia_Di_Musica_(FTS056)-Vinyl-2007-NBD (VBR V2)
Jack_Overdose_And_Dj_Terorist_-_Zwaf_(JOTC2)-Vinyl-2007-NBD (VBR V2)
Jacktronic_-_Deep_Red_Ep-Vinyl-2007-QMI (VBR V2)
Jacky_Core_-_La_La_Love-(KAK011)-Vinyl-2007-Jef (VBR V0)
Jacky_Core_-_La_La_Love__Shake_Your_Buddha-(KAK011)-Vinyl-2007-iHQ (VBR V2)
Jade-Dont_Walk_Away__Incl_Alan_Aztec_Remix-Promo_Vinyl-2007-SDS (VBR V2)
Jaja_Aka_Jajmahal-Acid_Beat_EP-(MACKITEKHS02)-Vinyl-2007-hM (VBR V2)
Jane_Ephex_-_When_I_Core_Around-(HBR002)-Vinyl-2007-FMC (VBR V2)
Javi_Crecente_Feat._Alyssia-The_Reason_Why-(FK-008-MX)-Vinyl-2007-OBC (VBR V2)
Jdx_-_Goddamn_Bitch__Tha_Seeker-(SCSP013)-WEB-2007-HB (CBR 320 kbps)
JDX_-_In_Da_Baze-(SCANTRAXX029)-Vinyl-2007-HB (VBR V2)
JDX-Goddamn_Bitch__Tha_Seeker-(SCSP013)-Vinyl-2007-HDF (VBR V2)
Jdx-In_Da_Baze-(SCADI029)-WEB-2007-UKHx (CBR 320 kbps)
Jeckyll_And_Hyde_-_Freefall-(SQUARE014)-Vinyl-2007-HB (VBR V2)
Jeckyll_And_Hyde_-_Freefall__Incl_The_Real_Booty_Babes_Mixes-CDM-2007-QMI (VBR V2)
Jeckyll_And_Hyde_-_Frozen_Flame__Incl_Rocco_And_Bass-T_Rmx-(CLT001)-Vinyl-2007-HB (VBR V2)
Jeckyll_and_Hyde-Freefall-(SQUARE014-3)-WEB-2007-HDF (CBR 320 kbps)
Jeckyll_And_Hyde-Freefall-CDS-2007-SND (VBR V2)
Jeff_Amadeus_Vs_Ganez_The_Terrible-Unrested_Beats-(HU080)-Vinyl-2007-hM (VBR V2)
Jendrik_De_Ruvo_And_Flarup_-_The_Hard_Way-(JMDD0031)-Vinyl-2007-FMC (VBR V2)
Jig_And_Saw_-_Damn_Tough__Wicked_Game-(BGR005)-Vinyl-2007-HB (VBR V2)
Jimmy_The_Sound_Vs_Daniele_Mondello_-_Hardstyle_Killer__One_More_Time_(SIGMA132)-Vinyl-2007-NBD (VBR V2)
Jli_Project_Vs_Switchblade-Gunrunners-(DADSFORZA09)-Vinyl-2007-MTC (VBR V2)
John_Dahlback-20_(Blink_and_Sting)_(PICK20)-WEB-2007-WEM (CBR 320 kbps)
John_Dahlback-Blink-CDM-2007-TWCMP3 (VBR V2)
John_Marks_-_Insanity__Incl_Jump_Nikan_Remix-(GDL002)-CDR-2007-OxY (VBR)
John_Marks_-_Insanity__Incl_Jump_Nikan_Remix-(GDL002)-CDR-2007-OxY (VBR V2)
John_Marks_Vs._the_moon_-_blow_the_speakers_(DV0739)-Vinyl-2007-NBD (VBR V2)
Johnny_7_-_Can_I_Suck_It_(ST4310)-Vinyl-2007-NBD (VBR V2)
Johnny_7_-_My_Style-(ST4312)-Vinyl-2007-UNiCORN (VBR V2)
Jon_The_Baptist_-_Emotions__Imperion-Vinyl-2007-QMI (VBR V2)
Jones_B_Front_-_Lunatick-(DJURED012)-WEB-2007-Wd (VBR V2)
Josh_and_Wesz_Present_Chickz_On_Fire_-_Natte_Asbak-(NC002)-WEB-2007-JiM (CBR 320 kbps)
Josh_And_Wesz_Present_Chickz_On_Fire_-_Natte_Asbak-Vinyl-2007-QMI (VBR V2)
Jowan_-_Ascendance__Awake_(SR0744-5)-Vinyl-2007-NBD (VBR V2)
Joy_Kitikonti_-_Mind_Attack-(FLMLTDA)-Vinyl-2007-HQEM (VBR V2)
JTB_And_DJ_Chuck-E__Vandall_-_Excitement__Dream_Machine-Vinyl-2007-QMI (VBR V2)
JTB_and_Jay_M_-_Control_Your_Mind__Intruder-(VTX005)-WEB-2007-HB (CBR 320 kbps)
Jts_-_Electronic_Cignus_Ep-(SIGMA0129)-Vinyl-2007-FMC (VBR V2)
Jts-Alleluia-Vinyl-2007-SND (VBR V2)
Julian_DJ_And_Davide_Sonar_-_Kickin_Tunes_Klassix_01-(KTX01)-Vinyl-2007-HB (VBR V2)
Julian_Dj_And_Davide_Sonar_-_Kickin_Tunes_Klassix_02-(KTX02)-Vinyl-2007-HB (VBR V2)
Julian_Dj_Vs_Bruno_Power-Cops-(BTE004)-Vinyl-2007-UNiT (VBR V2)
Jumping_Jacks-Your_Smile-(CDS)-2007-MTD (VBR V2)
Juppystyle_-_Techno_Trap-(GEE093)-Vinyl-2007-JiM (VBR V2)
Juppystyle_-_Techno_Trap_(GEE093)-WEB-2007-gnvr (CBR 320 kbps)
Kain_Marco__Steve_Hill_Vs_Technika_-_The_Storm__Evolution-Promo_Vinyl-2007-QMI (VBR V2)
Kamikaze_And_Mr_Eyez_-_Jack_Yo_Ballz_Off_Ep-(JKS013)-READ_NFO-Vinyl-2007-HB (VBR V2)
Kamiz_-_Kamiz_Song_(REMIXES)-(ATMM1)-Vinyl-2007-HB (VBR V2)
Kamui_-_Arena_(Incl_A.S.Y.S._remix)_(TT012)-Vinyl-2007-NBD (VBR V2)
Kanakk_Attakk_-_Marijuana-Promo-CDR-2007-ZzZz (VBR V2)
Kanakk_Attakk_-_Marijuana-Vinyl-2007-QMI (VBR V2)
Kaoz_and_S_Ewe_-_Die_Lustige_Welt_Der_Tiere-(NERVEN30)-Vinyl-2007-SQ (VBR V2)
Karl_Davis-Me_Maa-Vinyl-2007-MNS (VBR V2)
Karl_F_-_Night_Launch-(BABA081)-Vinyl-2007-HB (VBR V2)
Karl_F_-_Sinty_Pitch-(BABA076)-Vinyl-2007-HB (VBR V2)
Kat_Meets_Gerardo_Roschini_-_Alright-(DBS601)-WEB-2007-HB (CBR 320 kbps)
Kat_Meets_Gerardo_Roschini-Alright_(DBS601)-Vinyl-2007-NBD (VBR V2)
Kayem_And_Acesone-No_Gravity_(MOONDANCE_2007_ANTHEM)-CDS-2007-SDS (VBR V2)
Kayem_And_Likquid_-_We_Bring_The_Nu_Style_Ep-Vinyl-2007-QMI (VBR V2)
Kevin_Kaos-Ritalin__The_Attack-Vinyl-2007-SDS (VBR V2)
Kike_Dj_Vs_DJ_Sergio-If_Your_Not_This_Here-(PLAMIX007)-Vinyl-2007-OBC (VBR V2)
Kike_Dj-Dont_You_Love_Me-(CON-549-EP)-Vinyl-2007-OBC (VBR V2)
Kike_Reaktion_Vs_Aaron_the_Bass_-_Ripped-(CHR-614)-Vinyl-2007-NRG (VBR V2)
Kiker_-_Check_It_Out__Incl_DJ_Neutrinz_Remix-Vinyl-2007-QMI (VBR V2)
Kings_Of_Porn_-_Music_That_Will_Save_Your_Life-(ZOO022)-Vinyl-2007-HB (VBR V2)
K-Jael-Speakers__Commander_(HARD69_001)-Vinyl-2007-NBD (VBR V2)
Klone_-_Dragons_Lair-(GEE090)-WEB-2007-iHQ (CBR 320 kbps)
Kold_Konexion_And_Dj_Luna-Return_To_Zero-(SO0321)-Vinyl-2007-hM (VBR V2)
Kore-Tex_-_Bitch_Hos-Vinyl-2007-QMI (VBR V2)
Kutski-In_New_Djs_We_Trust-CABLE-08-11-2007-uC (VBR V2)
Lacuna_Origin_-_Sick_Of_Trance__They_Have_Forgotten_The_Machines-(BLU127)-WEB-2007-eST (CBR 320 kbps)
Lady_Sin-Delusion_(IMPACT003)-Vinyl-2007-NBD (VBR V2)
Langenhagen_-_Hamburg_Sued_2007-Vinyl-2007-QMI (VBR V2)
Lars_Palmas_-_Hope_For_Raveolution-Vinyl-2007-QMI (VBR V2)
Lars_Palmas-Hope_For_Raveolution-WEB-2007-Homely (CBR 320 kbps)
Lce_Ft._merayah_-_enola_gay-(23221936)-Vinyl-2007-hlsmp3 (VBR V2)
Le_Sphinx_-_The_Shot-(GEE092)-WEB-2007-iHQ (CBR 320 kbps)
Lee_Tall_Vs_Dj_Tronic_-_The_Globalization_Ep-Vinyl-2007-QMI (VBR V2)
Lethal_MG_-_Remixes-(CC014)-Vinyl-2007-HB (VBR V2)
Lethal_MG_And_Manu_Kenton_And_DJ_Ghost_-_Indian_Tonic-(SQUARE017)-Vinyl-2007-HB (VBR V2)
Lexis-Cardiac_Arrest_Special_3-(CARSP003)-Vinyl-2007-MTC (VBR V2)
Likquid_And_Kayem_-_We_Bring_The_Nu_Style__Dont_Be_Afraid-(DJURED014)-WEB-2007-eST (CBR 320 kbps)
Limpar_-_Destination_Unknown_(KT058)-Vinyl-2007-NBD (VBR V2)
Lobotomy_-_Everlasting-(ST002)-Vinyl-2007-HB (VBR V2)
Lobotomy_Inc_-_The_Album-(LOR010)-4xVinyl-2007-HB (VBR V2)
Lobotomy_Inc_-_The_Album-(LOR010)-TRACKFIX-4xVinyl-2007-HB (VBR V2)
Lolicon_-_Music_Lover__Own_Thiz-Promo-CDR-WEB-2007-DFM (CBR 192 kbps)
Looney_Tunez_-_Pound_It_Loud-Vinyl-2007-QMI (VBR V2)
Looney_Tunez_Present_-_A_Tribute_To_Klubb_EP-(TUFF642-12)-Vinyl-2007-HB (VBR V2)
Looney_Tunez_Vs_Doop_-_Doop_2007-CDS-2007-HB (VBR V2)
Lord_Of_Bass_-_Underground-(BM30)-WEB-2007-eST (CBR 320 kbps)
Louk_-_Shadow_Of_The_Beast-Vinyl-2007-QMI (VBR V2)
Luca_Antolini_Vs_Steve_Hill-Through_My_Memories-(RED282)-Vinyl-2007-MTC (VBR V2)
Lucky_And_Strike_-_Get_Laid-CDM-2007-HB (VBR V2)
Ludovic_Vendi_-_Magic_Morning__Sueno_X-(MINISKETCH06)-Promo_Vinyl-2007-HQEM (VBR V2)
Luigi_Magitteri_-_The_Emperor-(EXP003)-REPACK-Vinyl-2007-NBD (VBR V2)
Luigi_Magitteri_-_The_Emperor-(EXP003)-Vinyl-2007-NBD (VBR V2)
Luke_Spellbound_-_System_Shutdown-(SYS-X12)-WEB-2007-HB (CBR 320 kbps)
Luke_Spellbound_And_Nick_Arcane-Australian_Hardbass_Warriorz_(IMPR-03)-Vinyl-2007-NBD (VBR V2)
Luke_Spellbound_and_The_Mad_Kiwi_-_Make_Some_Noiz-(AH001)-WEB-2007-SOB (CBR 320 kbps)
Lunatic_Djs_-_Baby_Love-Promo_Vinyl-2007-QMI (VBR V2)
M_nd-Sensation_And_M-Bitious-Da_Heartbreak-Vinyl-2007-SDS (VBR V2)
Major_Bryce_-_In_Your_Face__Le_Narvalometre-Vinyl-2007-LiR (CBR 320 kbps)
Major_Bryce_-_Le_Narvalometre-Proper_Vinyl-2007-QMI (VBR V2)
Major_Bryce_-_Scary_School_The_First_Album_100_Mixed-CD-2007-UNiCORN (VBR V2)
Major_Bryce_-_Scary_School-Vinyl-2007-QMI (VBR V2)
Major_Bryce_And_DJ_Fred_Present_FFK_-_Rude_Boy_Sound__Disconnected-Vinyl-2007-QMI (VBR V2)
major_bryce-le_narvalometre-Vinyl-2007-snd (VBR V2)
Manox_-_Fly_With_Me__Clouds_Above-CDS-2007-CeZ (CBR 160 kbps)
Manu_Kenton_-_Mobility__Catch-(MK03)-Vinyl-2007-HB (VBR V2)
Manu_Kenton-Porn_Star__You_Got_It_All_(MK04)-Vinyl-2007-NBD (VBR V2)
Manuel_Jdem_-_Lets_Rock_It-(KT060)-Vinyl-2007-HB (VBR V2)
Marc_Smith_and_Arkitech_-_The_Body_Movin_EP-(NOTV004)-Vinyl-2007-FMC (VBR V2)
Marc_Stevens_And_Tim-E_-_Blow_The_Spot-Vinyl-2007-QMI (VBR V2)
Marcel_Fengler_-_Playground-(O-TON09)-Vinyl-2007-EMP (VBR V2)
Marco_Remus_-_Butan_EP-(NERVEN_35)-Vinyl-2007-UNiCORN (VBR V2)
Mark_Ankh-The_Man_You_Fear_EP-Vinyl-2007-USF (VBR V2)
Mark_V_and_Poogie_Bear-Turn_it_Up_EP_(MET004)-Vinyl-2007-NRG (VBR V2)
Mark_With_A_K_-_Distorted-(REV-005)-Vinyl-2007-HB (VBR V2)
Marlon_S_-_M.U.G.-(TREM019)-WEB-2007-iHQ (CBR 320 kbps)
Marlon_S-M.U.G.-(TREM021)-Vinyl-2007-QTXMp3 (VBR V2)
Masif_Djs_-_Awakening-Promo_Vinyl-2007-QMI (VBR V2)
Mason_-_Exceeder_(Coone_Remix)-(DWX003)-Onesided_Vinyl-2007-HB (VBR V2)
Massimo_Rizzi-Blackjack__Monitor_(SP002)-Vinyl-2007-NBD (VBR V2)
Masters_Of_Descency_feat_Xander_Coiffeur_-_Flipped__Hot_Damn-(RM073)-REPACK-Vinyl-2007-HB (VBR V2)
Mauro_Picotto-Now_and_Then-(0860CSWR)-CD-2007-BF (VBR)
Mauro_Picotto-Now_and_Then-(0860CSWR)-CD-2007-BF (VBR V2)
Max_B._Grant_And_The_Ripper_-_HS_Cops_2007-Vinyl-2007-QMI (VBR V2)
Max_B_Grant_And_Joaquin_Dj_-_Fire_Breeze-(SMC024)-Vinyl-2007-HB (VBR V2)
Max_B_Grant_And_Mdjaxx_And_Elex_Dj_-_Goliath_Anthem_07_(ZP04)-Vinyl-2007-NBD (VBR V2)
Max_B_Grant_Vs_Djanny_-_The_Jaegermeister_Effect-(ETX-0032.5)-Vinyl-2007-HB (VBR V2)
Max_B_Grant_Vs_The_Ripper-Im_The_Ripper-(BLU119)-Vinyl-2007-UNiT (VBR V2)
Max_Walder_-_La_Centrifugeuse-Vinyl-2007-QMI (VBR V2)
Max_Walder_-_Precioso-(SQUARELTD003)-Vinyl-2007-HB (VBR V2)
Max_Walder_Vs_Manu_Kenton_-_As_You_Want-(50HZ009)-Trackfix-Vinyl-2007-HB (VBR V2)
Maziano_-_Take_Control_Harder__Incl_Manox_Remix-Vinyl-2007-QMI (VBR V2)
MC_13unn_And_Br14n_M_-_Love-(EXP048)-WEB-2007-HB (CBR 320 kbps)
Mc_13unn_And_Br14n_M-Love-Vinyl-2007-SND (VBR V2)
Mc_Drill-Numbers_(Incl_Darksucker_Remix)_(PYR02)-Vinyl-2007-NBD (VBR V2)
Mc_Tr3no_-_Hell-(BOMB010)-Vinyl-2007-SQ (VBR V2)
Meadow_Inferno_-_Dance_Some_Shit-(DJ006)-Vinyl-2007-LiR (VBR V2)
Meadow_Inferno_-_Mid_Range-Vinyl-2007-QMI (VBR V2)
Meadow_Inferno_-_Reality_EP-(DJ004)-Vinyl-2007-SQ (VBR V2)
Mental_Theo_-_Jumpstyle_Madness-CD-2007-KTMP3 (VBR V2)
Mental_Theo-Jawzz-(CDS)-2007-gnvr (VBR V2)
Messiah_Inc._-_deep_throat-limited_Vinyl-2007-QMI (VBR V2)
Messiah_Inc_-_Hardstyle_Massacre_Vol_1-(BJCD1)-WEB-2007-eST (CBR 320 kbps)
Messiah_Inc_-_Hardstyle_Massacre_Vol_2-(BJCD2)-WEB-2007-eST (CBR 320 kbps)
Metrotraxx_And_Friends-15_Y_Anthem_(2322411-6)-Vinyl-2007-NBD (VBR V2)
Metrotraxx_Feat._le_pims_-_freaky_sound_ep_(2322136-6)-Vinyl-2007-NBD (VBR V2)
Mic-E_-_Age_Of_Freedom-(HH001)-WEB-2007-gnvr (CBR 320 kbps)
Mic-E-Get_Freaky-Vinyl-2007-SND (VBR V2)
Michael_Burkat_Vs_Lars_Klein_-_Second_Base_EP-Vinyl-2007-QMI (VBR V2)
Micky_Joint_And_Flower_2k_-_Keepa_(BTE005)-Vinyl-2007-NBD (VBR V2)
Microsome_-_Flight__Summer_Storm-(KOJ04)-Vinyl-2007-HB (VBR V2)
Mike_Nero_-_Spring__Incl_Andy_Jay_Powell_Mix-Promo_Vinyl-2007-QMI (VBR V2)
Mike_P_And_Kris_Maks_-_My_Mom_Can_Jump-(FB001)-Vinyl-2007-FQS (VBR V2)
Mikk_and_Square-Stronger_than_Before_(MIKK_REMIX)-AMPDIG012-WEB-2007-UKHx (CBR 320 kbps)
Mindstomper_Vs_The_Quakers-Screwheadz-(KAT043)-Vinyl-2007-HDF (VBR V2)
Minimalistix-Strugle_For_Pleasure_(EXTRA_MIXES)-Promo_CDS-2007-TWCMP3 (VBR V2)
Minimalistix-Whistling_Drive_(EXTRA_MIXES)-Promo_CDS-2007-TWCMP3 (VBR V2)
Miss_Mady_-_Come_On_Baby-Vinyl-2007-QMI (VBR V2)
Miss_N-Traxx_Vs_Crystal_Age_-_I_Get_Loud-Vinyl-2007-QMI (VBR V2)
Miss_Tess-X_-_Haya_Buddy-Vinyl-2007-QMI (VBR V2)
Mister_Stewart-Star-(HS001)-WEB-2007-UKHx (CBR 320 kbps)
Mono_Guru_-_Angel_(GRC067)-Vinyl-2007-NBD (VBR V2)
Montana_Max_And_Alberto_Narco-Overdrive_Speakers-(ECKO90_07)-Vinyl-2007-NRG (VBR V2)
Mr_Noba_-_Pannik__Montana-(ETRAXX002)-Repack-Vinyl-2007-HB (VBR V2)
Nagoom_-_Elements-(DD230780)-WEB-2007-Homely (CBR 192 kbps)
Nagoom_-_In_My_Mind__4x4-(DD230650)-WEB-READ_NFO-2007-Homely (CBR 192 kbps)
Nagoom_-_In_My_Mind__4x4-Vinyl-2007-QMI (VBR V2)
Nagoom-Elements_(DD230390)-Vinyl-2007-NBD (VBR V2)
Nagoom-Elements_(DD230780)_Trackfix-Vinyl-2007-NBD (VBR V2)
Nfaze_Presents_Dj_Ubri-Planet_Hardcore-(AR006)-WEB-2007-MK2 (CBR 320 kbps)
Nightbass_Dj_Team_-_Crazy_Girl__Incl_Ruud_And_Cadoc_Short_Mix-(TRAK072)-WEB-2007-eST (CBR 320 kbps)
Nightbass_Dj_Team-Crazy_Girl_(DXX007)-Vinyl-2007-NBD (VBR V2)
Nightmare_In_Rome_-_Midnight_Ep-Vinyl-2007-QMI (VBR V2)
nikki_bellamammella_-_last_rave-(KAK017)-promo_cdr-2007-ltk (VBR V2)
Nikki_Bellamammella_-_Last_Rave-(KAK017)-Vinyl-2007-HB (VBR V2)
Noise_Provider_-_Arret_Final-Vinyl-2007-QMI (VBR V2)
Noise_Provider_-_Bits_And_Bytes-(SQUARELTD002)-Vinyl-2007-HB (VBR V2)
Noisecontrollers_-_Against_All_Odds_(Fusion_037-5)-(320_KBPS)-2007-Tt (CBR 320 kbps)
Noisecontrollers_-_Creatures__Against_All_Odds-Vinyl-2007-QMI (VBR V2)
Noisecontrollers_-_Crump-(FUSION041-5)-Vinyl-2007-HB (VBR V2)
Noisecontrollers_Vs_Speedy_Bass_-_Wanna_Freak_You-(DJS016)-WEB-2007-Homely (CBR 192 kbps)
Noisecontrollers-Aliens-CDR-2007-QHS (VBR V0)
Noisecontrollers-Creatures__Against_All_Odds-(FUSION037-5)-WEB-2007-DFM_INT (CBR 320 kbps)
Noisecontrollers-Crump_(FUSION041-5)-WEB-2007-DFM (CBR 320 kbps)
Nu_Foundation-Takin_My_Time_EP-(WARPED020)-Promo_Vinyl-2007-UKHx (VBR V2)
Nuclear_Dope_-_Soundz_Dope-Vinyl-2007-QMI (VBR V2)
Nutty_T_-_Attention-(NUTTY007D01)-WEB-2007-eST (CBR 192 kbps)
Nutty_T_-_Demon_Of_Hardstyle__Push_Your_Ability_(BAM001)-WEB-2007-eST (CBR 320 kbps)
Nyko_feat_Koya_-_Maniac_Psyko-(ST003)-Vinyl-2007-HB (VBR V2)
Octave_One_Feat._Random_Noise_Generation_-_Off_The_Grid-(TRESOR229-Vinyl)-2007-DRUM (VBR V2)
Outsiders_-_Maneater-(PIBL003)-Vinyl-2007-HB_INT (VBR V2)
Outsiders_-_Maneater-(PIBL003)-WEB-2007-iHQ (CBR 320 kbps)
Outsiders_-_Origination-(PIBL002)-Vinyl-2007-HB (VBR V2)
Outsiders-99_Problems-2007-CDS-PROMO-HARDSTYLE (CBR 192 kbps)
Outsiders-Origination-(PIBL002)-WEB-2007-DFM (CBR 320 kbps)
Oxley-Fly-(BABA077)-Vinyl-2007-QTXMp3 (VBR V2)
Oxytraxx_-_R.O.C.K.I.N.G.-(23221356)-Vinyl-2007-LiR (VBR V2)


Paco_Rincon_Vs_the_Guardian_and_Supreme_Entity_-_99_Problems-(CHR-613)-TRACKFIX-Vinyl-2007-NRG (VBR V2)
Paco_Rincon_Vs_the_Guardian_and_Supreme_Entity_-_99_Problems-(CHR-613)-Vinyl-2007-NRG (VBR V2)
Paco_Rincon_Vs_The_Guardian_And_Supreme_Entity-99_Problems-(CHR-613)-PROPER_Vinyl-2007-OBC (VBR V2)
Palmas_N_Raven_-_Black_Edition_Anthem_(HS0365)-TRACKFIX-Vinyl-2007-ZzZz (VBR V2)
Palmas_N_Raven_-_Black_Edition_Anthem_(HS0365)-Vinyl-2007-ZzZz (VBR V2)
Panik-X_Trem_-_Come_Back-(KOJ03)-READ_NFO-Vinyl-2007-HB (VBR V2)
Paragod_Vs_Jason_X_-_Lazer_Sound-Vinyl-2007-QMI (VBR V2)
Party_Crasher_-_The_Jumper_2007-(23-22363-6)-Vinyl-2007-HB (VBR V2)
Party_Jumpers-The_Riddle__I_like_It_Loud-CDS-2007-TWCMP3 (VBR V2)
Pascal_Rolay_And_Friends_-_Yeah_Boy-(ST4311)-Vinyl-2007-HB (VBR V2)
Patrick_Bunton_-_Blow_Job_(TR3137)-Vinyl-2007-ZzZz (VBR V2)
Patrick_Bunton_-_Eternity__Jumping_Pumping-WEB-2007-SRG (CBR 192 kbps)
Patrick_Jumpen_-_One_Man_Army-CD-2007-KTMP3 (VBR V2)
Pau_Dj-Addicted_To_The_Bass_Ep-Vinyl-2007-SND (VBR V2)
Paul_Birken-Land_Of_The_Lost-(HALLUCIDITEHS07)-Vinyl-2007-hM (VBR V2)
Paul_T.-Can_I_Get_Some_(Remixes)-(CDS)-2007-gnvr (VBR V2)
Paul_T_-_Can_I_Get_Some_(Remixes)-(PIBL001-PROMO)-Vinyl-2007-HB (VBR V2)
Pavo_-_Elektronik__Tekno_Music-(FUSION-043-5)-WEB-2007-gnvr (CBR 320 kbps)
Pavo_-_Elektronik__Tekno_Musik-(FUSION043-5)-Vinyl-2007-HB (VBR V2)
Pavo_And_Blutonium_Boy_-_Floorkilla_2007-(BLU083-R)-WEB-2007-eST (CBR 320 kbps)
Pavo_And_Blutonium_Boy_-_This_Is_My_Floor-Proper_Vinyl-2007-QMI (VBR V2)
Pavo_And_Blutonium_Boy-This_Is_My_Floor-Promo-CDR-2007-DOC (VBR V2)
Paxi_-_Discoschlampe-Promo_Vinyl-2007-QMI (VBR V2)
Phase_Shifter_Vs_Geezer_-_Inferno__Gangster-(SYNCH003)-Promo_CDR-2007-iHQ (VBR V2)
Phase_Shifter_Vs_Geezer_-_Inferno__Gangster-WEB-2007-Vin (CBR 192 kbps)
Phil_York_And_Dark_By_Design-Monster_(ATUDE016)_Onesided_Bootleg-Vinyl-2007-NBD (VBR V2)
Phil_York_Ndj_And_Dark_By_Design-Boodang_Theme_(TRANZLATION012)-Vinyl-2007-NBD (VBR V2)
Phil_York_Vs_Dark_By_Design_-_Blow_You_Mind_(ATUDE009)-Onside_Bootleg-2007-NBD (VBR V2)
Phil_York_Vs_Dbd_-_The_Jed-Eye_March-(ATUDE010)-WEB-2007-eST (CBR 320 kbps)
Philippe_Rochard_-_Mash_Up-(SB013)-Vinyl-2007-HB (VBR V2)
Philippe_Rochard_-_Oldskool-Promo_Vinyl-2007-QMI (VBR V2)
Philippe_Rochard_-_Pirates-Limited_Vinyl-2007-QMI (VBR V2)
Philippe_Rochard_And_Da_Mouth_Of_Madness_-_Invites_(THE_ANTHEM)-Vinyl-2007-QMI (VBR V2)
Philippe_Rochard-Mash_Up-(SB013)-WEB-2007-gnvr (CBR 320 kbps)
Philippe_Rochard-Oldskool-(SB-LTD003)-WEB-2007-SSK (CBR 320 kbps)
Phobos-Dominion_Jump_(JPA01)-2007-NBD (VBR V2)
Photonic_-_Cayenna__El_Tabasco-(TTJ008)-WEB-2007-gnvr (CBR 320 kbps)
Pila_And_The_Scientist_-_My_Bitch-(SO0322)-Vinyl-2007-HB (VBR V2)
Plasmaboys_Ft_Vortex_-_Destiny__Pimp_Clap-(DRUM0703-6)-Vinyl-2007-HB (VBR V2)
Plazmavort-Hot_(KT061)-Vinyl-2007-NBD (VBR V2)
Point_Blanc-Beautiful_People__Iliowa_(BOMB0702-6)-Vinyl-2007-NBD (VBR V2)
Polycarpus_Vs_Decoo_-_My_Happiness-(JP9087)-Vinyl-2007-HB (VBR V2)
Pompanick_-_Fucking_Sound__Incl_Tunnel_Allstars_Remix-Vinyl-2007-QMI (VBR V2)
Popgirlz-Do_The_Jumpstyle-(CDS)-2007-gnvr (VBR V2)
Portal-Vol_5-(2FX005)-Vinyl-2007-DEF (VBR V2)
Pradera_-_Thunder__Get_Stupid-(DRUM0702-6)-Vinyl-2007-HB (VBR V2)
Pradera_-_Thunder__Get_Stupid-(DRUM07026)-WEB-2007-Homely (ABR)
Primax_-_Sameria__Depention-(TR3126)-RERIP-Vinyl-2007-FMC (VBR V2)
Primax-Stompin_(TR3140)-Vinyl-2007-NBD (VBR V2)
Project_Deviate-Not_My_Kind__Flash-(FUSION030-5)-WEB-2007-DFM_INT (CBR 320 kbps)
Radio_Head-Fade_Out-Repack-Onesided_Bootleg_Vinyl-2007-SDS (VBR V2)
Radium_-_Army-(BABA080)-Vinyl-2007-HB (VBR V2)
Radium_And_James_Rhandal_-_Stand_Up-(NEWS00050D)-WEB-2007-eST (CBR 320 kbps)
Radium_Meets_Audio_Damage-What_U_Want__Honk_That_Pussy_(FTS058)-Vinyl-2007-NBD (VBR V2)
Radium_Meets_Audio_Damage-What_U_Want_E.P.-WEB-2007-Homely (VBR V2)
Raine-Analog_Needle_Tweak__Fire-(SPK020)-Vinyl-2007-HDF (VBR V2)
Raine-Analogic_Needle_Tweak__Fire-(SPK020-5)-WEB-2007-DFM_INT (CBR 320 kbps)
Raine-Analogic_Needle_Tweak__Fire-Promo_CDS-2007-TWCMP3 (VBR V2)
Ramon_Salvador-Be_Alone-(RED016)-Vinyl-2007-OBC (VBR V2)
Ran_D_And_DJ_Pulse_meets_MC_Rems_-_Bomb_This_Place-WEB-2007-Homely (CBR 320 kbps)
Ran-D__Dj_Pulse__Mc_Rems-Bomb_This_Place_(DBS701)-Vinyl-2007-NBD (VBR V2)
Randv_Vs_Lny-Tnz_-_Chicago_Booty_EP-(TUFF640-12)-Vinyl-2007-HB (VBR V2)
Redbase_-_Knuckle_Of_Pork-Vinyl-2007-QMI (VBR V2)
Reflex_-_Lui_2007_Part_2__Incl_Verano_Remix-Promo_Vinyl-2007-QMI (VBR V2)
Refresh_-_A_Step_Too_Far-(JUMPIT002)-Vinyl-2007-HB (VBR V2)
Regi_And_Bp-Aaa_Anthem_(2322405-6)_Retail-Vinyl-2007-NBD (VBR V2)
Regi_Ft._scala-i_fail-(PROMO_CDM)-2007-egm (VBR V2)
Regi_ft_Scala_-_I_Fail-(23-22278-6)-Vinyl-2007-HB (VBR V2)
Rewired-Here_Comes_That_Sound-(YCUK032)-Vinyl-2007-XXL (VBR V2)
Rim_Shotters_Ft._DJ_Vortex_-_BTB__FTP_(STK129)-Vinyl-2007-NBD (VBR V2)
Rim_Shotters_Ft_Dj_Vortex-Btb_Ftp-(STK129)-WEB-2007-DFM (CBR 320 kbps)
Roberto_Narlito_-_I_Want_You_Now__Focus-(PIR011)-Vinyl-2007-HB (VBR V2)
Robin_Clark_-_F.T.T.O.-(BELT012)-Vinyl-2007-HB (VBR V2)
Ronald_V_Vs._q-ic_-_fucked_in_your_ass_(HV-01)_proper-Vinyl-2007-NBD (VBR V2)
Ronald-V_-_Rons_Beat-(HV02)-Vinyl-2007-HB (VBR V2)
Ronald-V_And_Q-Ic_-_Musique__Fucked_In_Your_Ass-(HV01)-Vinyl-2007-HB_INT (VBR V2)
Ronald-V_And_Q-Ic_-_Musique__Fucked_In_Your_Ass-Vinyl-2007-QMI (VBR V2)
Rts_-_Poing_2007-CDS-2007-QMI (VBR V2)
RTS_-_Poing_2007-Vinyl-2007-QMI (VBR V2)
Ruben_Dj_Vs_Dj_Varel_-_I_Feel_The_Heat_(AL005)-Vinyl-2007-NRG (VBR V2)
Rudy_Sunders_-_Pulse__Transformer-(KAK009)-Vinyl-2007-HB (VBR V2)
Rushtex-Exorcism_Of_Chucky-Vinyl-2007-SND (VBR V2)
Russenmafia_-_My_House__Dakrapo-Vinyl-2007-QMI (VBR V2)
S_Dee-Play_It_Harder-(JUMPB050)-WEB-2007-UKHx (CBR 320 kbps)
S_Dee-The_Dark_Side-(JUMPB49)-WEB-2007-UKHx (CBR 320 kbps)
Sacrifice_Presents_Project_Zero-Killer-(GNR003)-Vinyl-2007-OBC (VBR V2)
Sam_Punk_-_Hard_As_Steel__The_Album-(STRS100)-WEB-2007-eST (CBR 320 kbps)
Sam_Punk_-_Raise_Da_Fukk_Up-(CON020)-Vinyl-2007-HB (VBR V2)
Sam_Punk_Presents_Phuture_Punk-Need_Some_(Fukkin_Pillz)_(DBS901)-Vinyl-2007-NBD (VBR V2)
Sam_Punk_Vs._Dj_The_Crow_-_D.A.P._2007__sirens_of_time_(UED031)-Vinyl-2007-NBD (VBR V2)
Sam_Punk-Out_Of_Love_(TUFF646-12)-Vinyl-2007-NBD (VBR V2)
Sander_Van_Doorn-By_Any_Demand-Promo_CDM-2007-GTi (VBR V2)
Schwarzende_-_Rrroll_The_Bass_(OFL05)-Vinyl-2007-NBD (VBR V2)
Scooter_-_Lass_Uns_Tanzen__Incl_DJ_Zany_Remix-Vinyl-DE-2007-QMI (VBR V2)
Scope_DJ_-_Lockdown-(NC004)-Vinyl-2007-HB (VBR V2)
Scope_DJ_-_Lockdown__Protocol-(NC004)-WEB-2007-gnvr (CBR 320 kbps)
Scope_DJ_-_Protocol_E.P_PROMO_Vinyl-2007-HARDSTYLE (VBR V2)
S-Dee-Bang_Your_Sister-Promo_CDR-2007-HDF (VBR V2)
Sean_Apollo_and_DMO_-_I_Can_Feel_You_Now-(PLUS33)-Promo_Vinyl-2007-SQ (VBR V2)
Sean_Apollo_Fraud_and_Ionsphere-Obsession-DTD006-Vinyl-2007-XTC (VBR V2)
Sebastian_Prelar_-_Full_Metal_Jackin_EP-(CORP063)-Vinyl-2007-LiR (VBR V2)
Secret_Phunk-Producelast_(GRC070)-Vinyl-2007-NBD (VBR V2)
Sexy_Body_-_Jumping_Pumpkin-(KAK019)-Vinyl-2007-HB (VBR V2)
Sharkside_-_Strukture-Vinyl-2007-QMI (VBR V2)
Showtek_-_Album_Sampler_2-Vinyl-2007-QMI (VBR V2)
Showtek_-_Brain_Crackin-Promo-CDS-2007-Trg (CBR 320 kbps)
Showtek_-_FTS-(DMW015)-Vinyl-2007-HB (VBR V2)
Showtek_-_Fts-Promo-CDS-2007-Trg (CBR 192 kbps)
Showtek_-_Today_Is_Tomorrow_Album_Sampler_01-(DMW014)-WEB-2007-HB_INT (CBR 320 kbps)
Showtek_Feat_Mc_DV8_-_Shout_Out-(DMW018)-WEB-2007-iHQ (CBR 320 kbps)
Showtek_Ft._MC_DV8_and_EMC_-_Born_4_Thiz__Raver-(DMW013)-WEB-2007-HB (CBR 320 kbps)
Showtek_Ft_Mc_Dv8_-_Shout_Out-(DMW018)-Vinyl-2007-HB_INT (VBR V2)
Showtek_Ft_MC_DV8_And_EMC_-_Born_4_Thiz-(DMW013)-Vinyl-2007-HB (VBR V2)
Showtek_Vs_Bloodhound_Gang_-_Uhn_Diz_Tortion_(HIDES_CRAZY_BOOTLEG)-CDM-2007-HaT (CBR 192 kbps)
Showtek-Album_Sampler-(DMW014)-READ_NFO-Vinyl-2007-HDF (VBR V2)
Showtek-Album_Sampler_001-WEB-2007-Homely (VBR V2)
Showtek-Album_Sampler_2-(DMW017)-WEB-2007-DFM (CBR 320 kbps)
Showtek-Fts__Incl_Hard_Mix-(DMW015)-WEB-2007-UKHx (CBR 320 kbps)
Showtek-Today_Is_Tomorrow_Album_Sampler_1-(DMW014)-READ_NFO-WEB-2007-SSK (CBR 320 kbps)
Silver_Nikan_-_2_Chill-(PROMO_CDM)-2007-OqM (CBR 320 kbps)
Silvia_Diaz-I_Cant_Help_Myself_Remixes_(T3H929)-Vinyl-2007-NRG (VBR V2)
Simon_J._bergher-contaminated_sounds-(FTS059)-Vinyl-2007-NBD (VBR V2)
Sinus_Tunes_Ft_Joe_Nitro_-_Two_Evils__Rompa_Stompa-(DRUM0704-6)-Vinyl-2007-HB (VBR V2)
Sisma_DJ_-_Relax-(WEB)-2007-ATRium (CBR 320 kbps)
Sisma_Dj_Feat_Mc_Tr3no-People_Strong-Promo_Vinyl-2007-SND (ABR)
Skam_-_The_Final_Countdown-(TEC143)-Remix-Vinyl-2007-NBD (VBR V2)
Skydriver_-_Be_Quiet__Impressive-(BLU129)-WEB-2007-eST (CBR 320 kbps)
Skydriver_-_Victory-WEB-2007-CMF (VBR V0)
Skydriver-Victory_(ETX0033)-Vinyl-2007-NBD (VBR V2)
SL_Technicians_-_Youre_Ready-(ZOO030)-Vinyl-2007-HB (VBR V2)
Sl_Technicians_-_Youre_Ready-(ZOO030)-WEB-2007-iHQ (CBR 320 kbps)
Slap_And_Tickle-Dont_Go-(FASTDEX016)-WEB-2007-UKHx (CBR 320 kbps)
Sl-Tronic_-_99.9-Vinyl-2007-QMI (VBR V2)
Smashing_Guys_-_Pump_And_Loud-(WKD1075)-WEB-2007-HB (CBR 320 kbps)
Smashing_Guys_-_Pump_And_Loud-Vinyl-2007-QMI (VBR V2)
Smashing_Guys_-_Step_Inside_The_Party_(Zatox_Remix)-(WEB)-2007-ATRium (CBR 320 kbps)
Smilla_-_Maschinenstop-(KRD002)-WEB-2007-WiTF (CBR 320 kbps)
Socks_And_Sandals-Rishi_Saturn_EP-(MCOSM1020)-Vinyl-2007-NVS (VBR V2)
Sonic_Solutions_-_Logical_Song_2007-(23-22191-6)-Vinyl-2007-HB (VBR V2)
Sound_Soldiers-Frequenzy-(72790)-WEB-2007-MK2 (CBR 320 kbps)
Southstylers_-_Blending_Beats_E.P.-Vinyl-2007-QMI (VBR V2)
Southstylers_-_Crystal__Trippp-(DMW019)-READ_NFO-Vinyl-2007-HB (VBR V2)
Southstylers-Blending_Beats_Ep-(FUSION042-5)-WEB-2007-DFM (CBR 320 kbps)
Southstylers-Crystal__Trippp-(DMW019)-WEB-2007-DFM (CBR 320 kbps)
SP_23-Network_Repress_010_The_Cat_Spits_Back-(NTW23RP010)-Vinyl-2007-TrT (VBR V2)
Speedwave-Junior-(GEE057)-WEB-2007-DFM_INT (CBR 320 kbps)
SpinBall_-_Laughing_Matters-Vinyl-2007-QMI (VBR V2)
Splash-Blame_the_Moon-LIQ001-Vinyl-2007-XTC (VBR V2)
Starblue_Vs_DJ_Leizar_-_You_Are_My_Hero-(AD-0104-MX)-Vinyl-2007-MS (VBR V2)
Stee_Wee_Bee_-_Ultimate_Krocha_Anthem-(PROMO-CDS)-2007-DAW (VBR V2)
Stefan_Makoy_Vs_David_Marshall-Ducaty-(RHR023)-Vinyl-2007-EMF (VBR V2)
Stephy_-_Get_Down-(EXP046)-WEB-2007-HB (CBR 320 kbps)
Stephy-Get_Down-Vinyl-2007-SND (VBR V2)
steve_dexter_trax_-_hey-Vinyl-2007-qmi (VBR V2)
Steve_Hill_Vs_Dark_By_Design_-_Hypnotizin-Promo_Vinyl-2007-QMI (VBR V2)
Stressfaktor_Projekt-Your_Dj-Promo_Vinyl-2007-SND (ABR)
Stressfaktor-Your_DJ_Panther-(ETX-0031_5)-READ_NFO-Retail_Vinyl-2007-HDF (VBR V2)
Stunt_Crew_Feat._E-Max_-_The_Remix_E.P.-(HRSPE01)-Vinyl-2007-FQS (VBR V2)
Stunt_Crew_feat_E-Max_-_The_Remix_EP-(HRSPE01)-PROPER-Vinyl-2007-HB (VBR V2)
Stylez_Meets_Tonteufel_-_Hardsound_Blitz__Mono_Tune-Promo-CDR-2007-ZzZz (VBR V2)
Stylez_Meets_Tonteufel_-_Mono_Tune__The_Hardsound_Blitz-(Vinyl)-READ_NFO-2007-Daw (VBR V2)
Stylez_Meets_Tonteufel_-_Third_Strike-(HS0317)-Vinyl-2007-FMC (VBR V2)
Stylez_Meets_Tonteufel-Third_Strike-Promo-Cdm-2007-ZzZz (VBR V2)
Sunics_-_Check_This_Out-Vinyl-2007-QMI (VBR V2)
Superstar_DJ_-_Meet_Her_At_The_Love_Parade-CDM-2007-HB (VBR V2)
Sweet_Candy-Higher-(P-819-12)-Vinyl-2007-OBC (VBR V2)
Sysmologic_Vs._Mico_DJ_-_Revitalize-(WEB)-2007-ATRium (CBR 320 kbps)
T.Comissi_Feat._Kaz_-_Give_Me-(D10MX008)-WEB-2007-NRG (CBR 320 kbps)
T_And_T-Gangsta_(BTE010)-Vinyl-2007-NBD (VBR V2)
T4t4nk4_-_Lets_Rock-(DJUZ010)-WEB-2007-JiM (CBR 320 kbps)
T4t4nk4_-_Lets_Rock-Vinyl-2007-QMI (VBR V2)
Taiko_-_The_Real_Kalinka-(PROMO-CDS)-2007-DAW (VBR V2)
Tat_And_Zat-Gold_Medley_With_Strange-(DBS801)-Vinyl-2007-MTC (VBR V2)
Tat_And_Zat-Gold_Medley_With_Strange-WEB-2007-Homely (CBR 320 kbps)
Tatact_-_Suck_My_Style-(ACT069)-WEB-2007-iHQ (CBR 320 kbps)
Tatact-Suck_My_Style-Vinyl-2007-SND (VBR V2)
Tatanka_-_Mess_Up__Repumped_(DJUZ08)-Vinyl-2007-NBD (VBR V2)
Tatanka_-_Tats_Mash_Up-Vinyl-2007-GEiL (CBR 192 kbps)
Tatanka-Mess_Up-(DJUZ008)-WEB-2007-UKHx (CBR 320 kbps)
Tatanka-Mess_Up__Repumped-(DJUZ08)-Proper-Vinyl-2007-HDF (VBR V2)
Taument_-_Warriors_Of_Hardstyle_Ep-(HPR001)-WEB-2007-eST (CBR 320 kbps)
Technoboy_-_Into_Deep-(AQL105)-Vinyl-2007-DJ (VBR V2)
Technoboy_-_Into_Deep-Promo_CDM-2007-NBD (VBR V2)
Technoboy_-_Vita__Angel_Heart-(TTC038)-WEB-2007-JiM (CBR 320 kbps)
Technoboy_-_Vita__Angel_Heart-Vinyl-2007-QMI (VBR V2)
Technoboy-Into_Deep-CDM-2007-SOFT (VBR V2)
Techpoint-Xstatic_Anthem-(LTD.ED._CDS)-2007-SMO (VBR V2)
Teequee_-_Popcorn-(SPR006)-Promo_Vinyl-2007-HB (VBR V2)
Tek_Soldiers_-_Wild_Style-(RESLIM_01)-Vinyl-2007-HB_INT (VBR V2)
Tek_Soldiers_-_Wild_Style_(RESLIM_01)-Limited_Edition-2007-KTB (VBR V2)
Teka_B_Ft_Babyshark_-_Fatal_Brain_Ep-(KANG1003)-Vinyl-2007-HB (VBR V2)
Teoria_Traxx_-_Bass_From-(ATM41)-Vinyl-2007-FQS (VBR V2)
The_Abyss_And_Justin_Putuhena_-_Bass_Reactor-(CON021)-Vinyl-2007-HB (VBR V2)
The_Artist_Also_Known_As_-_Eating_Donuts_EP-(ZOOLTD001)-Vinyl-2007-HB (VBR V2)
The_Bass_Brothers_-_Summer_EP-(FS-001-V)-Vinyl-2007-HB (VBR V2)
The_Beholder_Meets_DJ_Zany_-_Midnight-(SMC021)-WEB-2007-HB (CBR 320 kbps)
The_Highstreet_Allstars_-_Rock_This-CD-2007-HB (VBR V2)
The_Hose_-_Titanic_Remix_Collection_Vol_4_(Part_2)-(TTC036)-WEB-2007-JiM (CBR 320 kbps)
The_Hose-The_Pressure-(BLQ049)-WEB-2007-1REAL (CBR 320 kbps)
The_Jack_Foundation_-_Jack_Yo_Ballz_Off_Ep-(JKS013)-Proper_Vinyl-2007-UNiCORN (VBR V2)
The_Jumpers-Blue_(Da_Ba_Dee)-(CDS)-2007-gnvr (VBR V2)
The_Jumpmasters_-_Taste_Of_Summer-CDS-2007-Vaporized (VBR V2)
The_Jumpmasters-Skydive-(CDS)-2007-gnvr (VBR V2)
The_Kgbs_-_Fahrenheit-WEB-2007-Homely (CBR 320 kbps)
The_Kgbs_-_Superdisco-(POLL285)-Retail_Vinyl-2007-HB_INT (VBR V2)
The_Kgbs_-_Superdisco-(POLL285)-WEB-2007-iHQ (CBR 320 kbps)
The_Living_-_Rising_Skies-Promo_Vinyl-2007-QMI (VBR V2)
The_Machine_-_Butterfly_Ep-(KAT047)-WEB-2007-Homely (CBR 320 kbps)
The_Machine_-_Welcome_Chaos-(JUMP56-X)-WEB-2007-iHQ (CBR 320 kbps)
The_Machine-Butterfly_Ep_(KAT047)-Vinyl-2007-NBD (VBR V2)
The_Machine-Murder_Orchestra__Remixes-WEB-2007-HiROSHiMA (CBR 320 kbps)
The_Machine-Plastic_Mechanism-(JUMPB51)-WEB-2007-NRG (CBR 320 kbps)
The_Maxxx-Baby_Wants_To_Ride-CDS-2007-DOH (VBR V2)
The_Nasty_Boyz-Angel-(POLL287)-(WEB)-2007-gnvr (CBR 320 kbps)
The_Nasty_Trio_-_Hype_My_Dick-(DWX004)-Vinyl-2007-HB (VBR V2)
The_Pitcher_-_Control__Sleeping_(SPK021-5)-WEB-2007-DFM (CBR 320 kbps)
The_Pitcher_-_New_World__Underwater-(SPK023-5)-Vinyl-2007-HB (VBR V2)
The_Pitcher-Control__Sleeping-(SPK021-5)-Vinyl-2007-HDF (VBR V2)
The_Pitcher-New_World-(SPK023-5)-WEB-2007-hM (CBR 320 kbps)
The_Playboyz_-_Check_One-(ZOO026)-Vinyl-2007-HB (VBR V2)
The_Playboyz_-_Ghost_Story-(GS07001)-Vinyl-2007-HB (VBR V2)
The_Prophet_Feat_Headhunterz_-_High_Rollerz-WEB-2007-Homely (CBR 320 kbps)
The_Prophet_Feat_Headhunterz_-_Scar_Your_Face__High_Rollerz-(SCAN-RELOAD03-PROMO)-Promo_Vinyl-2007-HB (VBR V2)
The_Prophet_Vs_Deepack-Stampuhh_Remixes-WEB-2007-Homely (CBR 320 kbps)
The_Raiders_-_A_Feeling-(POLL284)-Vinyl-2007-iHQ (VBR V2)
The_Raiders_-_A_Feeling-(POLL284)-WEB-2007-HB_INT (CBR 320 kbps)
The_Raiders-A_Feeling-(POLL284)-WEB-2007-SSK (CBR 320 kbps)
The_Raiders-A_Feeling-WEB-2007-Homely (VBR V2)
The_Retro_Project_-_Das_Boot-(23-22192-6)-Vinyl-2007-HB (VBR V2)
The_Ripper_Vs_Jack_Blade_-_The_Collection-Vinyl-2007-QMI (VBR V2)
The_Ripper_Vs_Miss_Electra-The_Collection_Pt_2_(SIGMA0135)-2007-NBD (VBR V2)
Therapia_Ft_Kube-Meaning_Of__White_Noise_(ST4313)-Vinyl-2007-NBD (VBR V2)
Thrillogy_Allstars_-_Thrillogy_2007_The_Anthem-(THRILL001)-Vinyl-2007-HB (VBR V2)
Tiborc_Omaro_-_Blasting_EP-(555008)-Vinyl-2007-SOB (VBR V2)
Tignino_And_Leo_Feat_Mark_Kerr-How_Can_You_Feel-Vinyl-2007-SND (VBR V2)
Tipsy_T-Pump_That_Shit-(KAN008)-WEB-2007-UKHx (CBR 320 kbps)
Tom_Food_vs_Sam_Parker_-_Labo_002_(Magicals_Experiences)-(ATLP2)-2xVinyl-2007-JEF (VBR V0)
Tom_Food_Vs_Sam_Parker_-_Labo_002_(Magicals_Experiences)-(ATLP2)-2xVinyl-2007-UNiCORN (VBR V2)
Tommy_Pulse_-_Rammelpot-(STIND011)-Vinyl-2007-SQ (VBR V2)
Topmodelz_-_Heartbeat_(Incl_Silver_Nikan_Jumpstyle_Remix)-(PROMO-CDR)-2007-DAW (VBR V2)
Tornadozzer_-_Addicted_To_Hardstyle__Work_Your_Body-Vinyl-2007-QMI (VBR V2)
Toxwen_-_Toxwennology_Ep-(HRDL005)-Vinyl-2007-HB (VBR V2)
Trance_Generators-Italians_Do_It_Better-(FTS054PD)-Vinyl-2007-UNiT (VBR V2)
Trilok_And_Chiren_Vs_Alpha2_-_Straight_To_Hell-(MYTH008)-Vinyl-2007-HB (VBR V2)
Tronik-Lapse_Of_Memory_(ATH128)-Vinyl-2007-NBD (VBR V2)
Tsonami-Come_Back_to_Me_Baby-Promo_CDM-2007-B2R (VBR V2)
Tuneboy_-_Wackyjackie-(TTC037)-WEB-2007-JiM (CBR 320 kbps)
Tuneboy_-_Wackyjackie__Incl_Technoboy_Remix-Vinyl-2007-QMI (VBR V2)
Tunnel_Allstars_Feat._DJ_Yanny_-_Flug_Auf_Dem_Gluecksdrachen-(TR3119)-CDM-2007-MOD (VBR V2)
Tunnel_Allstars_Feat_DJ_Yanny_-_Crocketts_Theme-(TR3136)-Vinyl-2007-QMI (VBR V2)
Tweetwoof_-_Qwerty_(TEC146)-Vinyl-2007-NBD (VBR V2)
U-3505_-_Perturbations-(555004)-Vinyl-2007-HB (VBR V2)
Ueberdruck_And_Mass_In_Orbit-Xtc_Love_(UBD032)-Vinyl-2007-NBD (VBR V2)
Umberto_Fulci_-_Spoiler_Trax_Vol_4-(DF5527)-WEB-2007-WiTF (CBR 320 kbps)
Unknown_-_Egg_New_Style-Promo_Vinyl-2007-NRG (VBR V2)
Unknown_-_No_Alternative_(ATUDE011)_Onesided_Bootleg-Vinyl-2007-NBD (VBR V2)
Unknown_-_Nobody_Likes-Onesided_Bootleg_Vinyl-2007-QMI (VBR V2)
Unknown_-_Schranz_Insomnia-(SCHRANZS011)-Bootleg_Vinyl-2007-FMC (VBR V2)
Unknown_-_Smack_My_Arsch-(NERVEN034)-Vinyl-2007-HB (VBR V2)
Unknown-Orange_Theme_(ATUDE012)_REPACK-Vinyl-2007-NBD (VBR V2)
Urisk_And_Vitani_Meet_Glowiej_-_Vibes_Ep-(SJ009)-Vinyl-2007-HB (VBR V2)
Urts_-_Mega_Progress-(HR008)-Vinyl-2007-HB (VBR V2)
VAlkyria_-_Radio_Rave_Live-(WEB)-2007-ATRium (CBR 320 kbps)
VAndall-Ardcore-(TWZDIG008)-WEB-2007-UKHx (CBR 320 kbps)
Vicente_One_More_Time_-_El_Reino_Del_Hardstyle-Vinyl-2007-QMI (VBR V2)
Vicente_One_More_Time_-_El_Tren__Yambo-(BLU122)-WEB-2007-eST (CBR 320 kbps)
Viko_and_Talasemik-Untitled-(ARCHITEK04)-Vinyl-2007-CT (VBR V2)
Vincent_One_More_Time_Vs_DJ_Corely_-_El_Tren__Yambo-Vinyl-2007-QMI (VBR V2)
Vincent_Price_-_Spell_The_Dance-(PROMO-CDS)-2007-DAW (VBR V2)
Vincente_One_More_Time_-_La_Musica_Es_(MHM01)-Vinyl-2007-JiM (VBR V2)
Vodka_Brothers_-_Bullet-Promo_Vinyl-2007-QMI (VBR V2)
Vodka_Brothers_-_Funky_Noise-Promo_Vinyl-2007-QMI (VBR V2)
Vorwerk-Dreams-(SQUARE018)-WEB-2007-DFM (CBR 320 kbps)
Vrtx_And_Friends_-_Da_Vorti_Code-Vinyl-2007-QMI (VBR V2)
Vrtx_Meets_Coyote_-_Wonderfull_Ep-Promo_Vinyl-2007-QMI (VBR V2)
Walt_Jenssen_-_Ctrl_Walt_Del-Onesided_Vinyl-2007-QMI (VBR V2)
Walt_Jenssen_-_Walt_Mart__Waltstreet-(DMW020)-Vinyl-2007-JiM (VBR V2)
Walt_Jenssen_-_Walt_Mart__Waltstreet_(DMW020)-WEB-2007-gnvr (CBR 320 kbps)
Walt_Jenssen_-_Waltmart__Waltstreet-(DMW020)-READ_NFO-Vinyl-2007-HB_INT (VBR V2)
Warmduscher_-_Slow_it-(BLU126)-WEB-2007-eST (CBR 192 kbps)
Warmduscher_-_Stow_It_(Halts_Maul)_Remixes-(BLU126R)-WEB-2007-eST (CBR 320 kbps)
Waverunner_-_Back_On_The_Track__Ashton-(DP7937)-WEB-2007-eST (CBR 320 kbps)
Wex_Vs_Teka_B_-_Weekend_Ep-(KANG1004)-Vinyl-2007-HB (VBR V2)
Wild_Motherfuckers_-_Fother_Mucker-(DJUZ009)-WEB-2007-gnvr (CBR 320 kbps)
Wild_Motherfuckers_-_Fother_Mucker-Vinyl-2007-QMI (VBR V2)
Wildstylez_-_K.Y.H.U.__Clubbin-(SCANTRAXX032)-Vinyl-2007-HB (VBR V2)
Wildstylez_-_Lifez_A_Bitch-(SCREL005)-WEB-2007-HB (CBR 320 kbps)
Wildstylez_-_Lifez_A_Bitch__Missin-Vinyl-2007-QMI (VBR V2)
Wildstylez-K.Y.H.U.__clubbin-WEB-2007-Homely (CBR 192 kbps)
Wingmen-Surrender-(BCR009)-WEB-2007-UKHx (CBR 320 kbps)
Wordenz-Mc_Drunk_(KOJ008)-Vinyl-2007-NBD (VBR V2)
Xavi_And_Calypso_-_The_Unforgetable__Party_Amandement-Proper_Vinyl-2007-QMI (VBR V2)
Xavi_and_Calypso_-_The_Unforgettable-(HC004)-WEB-2007-HB (CBR 320 kbps)
X-Tech-Boost_The_Party-(TKX001-RP)-Vinyl-2007-hM (VBR V2)
Yago_The_Dominator_-_Rich_In_Out-Vinyl-2007-QMI (VBR V2)
Ydnass_And_Lobotomy_Inc_-_Scream-Vinyl-2007-QMI (VBR V2)
Yn_Fainagh-Acceleration_(PYR01)-Vinyl-2007-NBD (VBR V2)
Zairon_-_Acid_Park_(Zatox_Mix)-(WEB)-2007-ATRium (CBR 320 kbps)
Zairon_-_Deep_Into_Your_Soul-(IPN075)-WEB-2007-Heartbeat (CBR 320 kbps)
Zairon_-_Deep_Into_Your_Soul_(IPNO075)-Vinyl-2007-NBD (VBR V2)
Zairon__Smashing_Guys_-_Remix_01-Vinyl-2007-QMI (VBR V2)
Zairon_And_Smashing_Guys_-_Remix_01-(IPNO076)-WEB-2007-Homely (CBR 320 kbps)
Zany_And_Duro_-_Back_Again_-_Hasta_La_Pasta-(DMW012)-WEB-2007 (CBR 320 kbps)
Zany_and_Duro_-_Back_Again__Hasta_La_Pasta-(DMW012)-WEB-2007-HB_INT (CBR 320 kbps)
Zany_And_Duro_-_Back_Again__Hasta_La_Pasta-Vinyl-2007-QMI (VBR V2)
Zany_and_DV8_-_Nothing_Else_Matters-(FUSION038-5)-Vinyl-2007-HB (VBR V2)
Zany_And_Dv8_-_Nothing_Else_Matters-(FUSION038-5)-WEB-2007-iHQ (CBR 320 kbps)
Zany_Meets_The_Beholder_-_Annihilating-(FUSION039-5)-Vinyl-2007-HB (VBR V2)
Zany-Volt__Inflator-(FUSION035-5)-WEB-2007-DFM_INT (CBR 320 kbps)
Zappaman_-_Lawn_Mower-(POLL280)-WEB-2007-HB (CBR 320 kbps)
Zappaman-Lawn_Mower-(POLL280)-Repack-Vinyl-2007-UNiT (VBR V2)
Zappaman-Lawn_Mower-(POLL280)-Vinyl-2007-UNiT (VBR V2)
Zatox_-_Piper_Cut-(WEB)-2007-ATRium (CBR 320 kbps)
Zatox_And_Activator_-_Cant_Stop__So_Fight-(WKD1077)-WEB-2007-HB (CBR 320 kbps)
Zatox_And_Activator_-_Cant_Stop__So_Fight-Vinyl-2007-QMI (VBR V2)
Zatox_And_Activator_-_Dont_Let_It_Go-Vinyl-2007-QMI (VBR V2)
Zatox_And_Activator-Dont_Let_It_Go-WEB-2007-Homely (CBR 320 kbps)
Zenith_Dj_-_Once_Again-Vinyl-2007-QMI (VBR V2)
Zenith_DJ-Once_Again-(TRC014)-WEB-2007-BPM (CBR 320 kbps)
Ziggy_X-Stormy_Crowd-WEB-2007-SOFT (CBR 320 kbps)
Ztx_And_Kingsman_-_Smokin_N_Pourin_(DBS401)-Vinyl-2007-NBD (VBR V2)
Ztx_And_Kingsman_-_Smokin_N_Pourin-WEB-2007-Homely (CBR 320 kbps)


VA_-_10_Years_Records_Mania_Phase_1-CD-2007-LiR (VBR V2)
VA_-_10_Years_Records_Mania_Phase_2-CD-2007-LiR (VBR V2)
VA_-_50_Hardstyle_Tunes_2-2CD-2007-KTMP3 (VBR V2)
VA_-_50_Hardstyle_Tunes-2CD-2007-HB (VBR V2)
VA_-_100_Percent_Hardstyle-CD-2007-KTMP3 (VBR V2)
VA_-_100_Percent_Tuning_2_Mixed_By_Dj_Luna-CD-2007-KTMP3 (VBR V2)
VA_-_100_Percent_Tuning_3_Mixed_By_Dj_Marcky-CD-2007-KTMP3 (VBR V2)
VA_-_1000_Percent_Hardstyle-CD-2007-ZzZz (VBR V2)
VA_-_Acid_Bitch-(DPX-001)-Vinyl-2007-LiR (VBR V2)
VA_-_Arena_By_Miro-(EDNCD044)-CD-2007-iHQ (VBR V2)
VA_-_Atomic_Techno_Dynamic_Edition_3-(ATD3)-Vinyl-2007-HB (VBR V2)
VA_-_Atomic_Techno_Dynamic_Edition_4_(ATD4)-Vinyl-2007-KTB (VBR V2)
VA_-_Bababox_2007-(BABABOX2007)-READ_NFO-6xVinyl-2007-FQS (VBR V2)
VA_-_Bababox_2007-(BOX2007)-REPACK-PROPER-6xVinyl-2007-HB (VBR V2)
VA_-_Bass__and__Beatz_Vol._1-2CD-2007-JiM (VBR V2)
VA_-_Bassdusche_Vol_3-2CD-2007-MOD (VBR V2)
VA_-_Bassdusche_Vol_4-2CD-2007-QMI (VBR V2)
VA_-_Bassleader_2007_Compilation-2CD-2007-KTMP3 (VBR V2)
VA_-_Belgian_Jumpstyle_Top_100-2CD-2007-KTMP3 (VBR V2)
VA_-_Belgian_Jumpstyle_Vol.2_(72-763)-Vinyl-2007-NRG (VBR V2)
VA_-_Belgian_Jumpstyle_Vol_1-(72-762)-Vinyl-2007-NRG (VBR V2)
VA_-_Best_of_Hardstyle_(FEBRUARI)-WEB-2007-DFM (CBR 320 kbps)
VA_-_Blutonium_Presents_Hardstyle_Vol_11-2CD-2007-JiM (VBR V2)
VA_-_Blutonium_Presents_Hardstyle_Vol_12-2CD-2007-MOD (VBR V2)
VA_-_Blutonium_Presents_Hardstyle_Vol_13-2CD-2007-MOD (VBR V2)
VA_-_Clubbing-CD-2007-UNiCORN (VBR V2)
VA_-_Complex_File_2-CD-2007-KTMP3 (VBR V2)
VA_-_Complex_File_3-CD-2007-KTMP3 (VBR V2)
VA_-_Dance_Pollution_Remix_Collection__Volume_2-Proper_Vinyl-2007-QMI (VBR V2)
VA_-_Dance_Pollution_Remix_Collection_Volume_2-(POLL282)-WEB-2007-HB_INT (CBR 320 kbps)
VA_-_Dance_Pollution_Remix_Collection_Volume_2-(POLL282)-WEB-2007-Homely (CBR 192 kbps)
VA_-_Deadstyle_Is_Hard-(SYS-X14)-WEB-2007-HB (CBR 320 kbps)
VA_-_Deadstyle_Is_Hard-Vinyl-2007-QMI (VBR V2)
VA_-_Decibel_2007-3CD-2007-KTMP3 (VBR V2)
VA_-_Decibel_Outdoor_Festival_2007-3CD-2007-GMP3 (VBR V0)
VA_-_Defqon_One_Festival_2007-3CD-2007-HB (VBR V2)
VA_-_Del_Sampler_Vol.2_(DELSAMP002)-Vinyl-2007-JiM (VBR V2)
VA_-_Destination_Hardstyle_(SIGMA03CD)-CD-2007-iHQ (VBR V2)
VA_-_Dirty_Sneakerz_1-Vinyl-2007-QMI (VBR V2)
VA_-_Dj_Networx_E.P._Vol._6_(TR3131)-Vinyl-2007-NBD (VBR V2)
VA_-_DJ_Networx_Vol_31-2CD-2007-MST (VBR V2)
VA_-_DJ_Networx_Vol_32-2CD-2007-MOD (VBR V2)
VA_-_DJ_Networx_Vol_33-2CD-2007-MOD (VBR V2)
VA_-_DJ_Networx_Vol_34-2CD-2007-MOD (VBR V2)
VA_-_DJ_Ruthless_Presents_Jump_Part_5-CD-2007-HB (VBR V2)
VA_-_Djs_United_Remix_Files_Vol.1-WEB-2007-SRG (CBR 320 kbps)
VA_-_Dorian_Gray_Compilation_Volume_1-2CD-2007-QMI (VBR V2)
VA_-_Explosive_Cartuning_13-Repack-2CD-2007-LiR (VBR V2)
VA_-_Explosive_Cartuning_14-2CD-2007-LiR (VBR V2)
VA_-_Explosive_Cartuning_15-2CD-2007-KTMP3 (VBR V2)
VA_-_Explosive_Cartuning_Yearmix_2007-CD-2007-KTMP3 (VBR V2)
VA_-_Extrem_Bass_Vol_3-2CD-2007-ZzZz (VBR V2)
VA_-_Front_Da_Bass_Sampler_1-Vinyl-2007-QMI (VBR V2)


VA_-_Gary_D._presents_D-Techno_16-3CD-2007-MOD (VBR V2)
VA_-_Ghoststyle_Allstars-(GS07002)-Vinyl-2007-HB (VBR V2)
VA_-_Global_Hardstyle_(THE_FIRST_CHAPTER)-2CD-2007-QMI (VBR V2)
VA_-_Goliath_07-2CD-2007-QMI (VBR V2)
VA_-_Hands_Up_For_Hardstyle-2CD-2007-ZzZz (VBR V2)
VA_-_Hard_Dance_2_Mixed_By_Mystery_And_Norman-2CD-2007-HB (VBR V2)
VA_-_Hard_EP_(72728)-Vinyl-2007-NRG (VBR V2)
VA_-_Hard_Nature_The_Natural_Hardstyle_Compilation_Mixed_By_Nagoom-2CD-2007-KTMP3 (VBR V2)
VA_-_Hard_With_Style_Vol_2-2CD-2007-HB (VBR V2)
VA_-_Hardbass_Chapter_10-2CD-2007-MOD (VBR V2)
VA_-_Hardbass_Chapter_11-2CD-2007-MOD (VBR V2)
VA_-_Hardbass_Chapter_12-2CD-2007-MOD (VBR V2)
VA_-_Hardbass_Vol_7-2CD-2007-SQ (VBR V2)
VA_-_Hardstyle_Bass_Vol_2-2CD-2007-MOD (VBR V2)
VA_-_Hardstyle_Classics_Top_100-3CD-2007-KTMP3 (VBR V2)
VA_-_Hardstyle_Generation_X_Mixed_By_Nitemare_Steve-2CD-Bootleg-2007-iMC (VBR V2)
VA_-_Hardstyle_Gladiators_(THE_FIRST_FIGHT)-2CD-2007-QMI (VBR V2)
VA_-_Hardstyle_Hypes_Part_2_(MIXED_BY_BRAINHEADZ)-CD-2007-ZzZz (VBR V2)
VA_-_Hardstyle_Kixx-CD-2007-SVB (VBR V3)
VA_-_Hardstyle_Mania_Vol_5-2007-MOD (VBR V2)
VA_-_Hardstyle_Mania_Vol_6-CD-2007-ESA (VBR V2)
VA_-_Hardstyle_Megamix_Vol.4-2CD-2007-SYNDIKAT (VBR V2)
VA_-_Hardstyle_Religion_Vol_1_(Mixed_By_Zenith_And_D8r_Zot)-(ATL334-2)-2CD-2007-iHQ (VBR V2)
VA_-_Hardstyle_Sessions_8-2CD-2007-MOD (VBR V2)
VA_-_Hardstyle_The_Ultimate_Collection_2007_Vol_1-2CD-2007-KTMP3 (VBR V2)
VA_-_Hardstyle_The_Ultimate_Collection_2007_Vol_2-2CD-2007-KTMP3 (VBR V2)
VA_-_Hardstyle_The_Ultimate_Collection_2007_Vol_3-2CD-2007-KTMP3 (VBR V2)
VA_-_Hardstyle_The_Ultimate_Collection_Best_Of_2007-3CD-2007-KTMP3 (VBR V2)
VA_-_Hardstyle_Top_20__2007_Volume_1-CD-2007-LiR (VBR V2)
VA_-_Hardstyle_Top_50_Part_2-3CD-2007-HB (VBR V2)
VA_-_Hardstyle_Top_50_Part_3-3CD-2007-HB (VBR V2)
VA_-_Hardstyle_Top_50-3CD-2007-LiR (VBR V2)
VA_-_Hardstyle_Top_100_Vol._4-2CD-2007-JiM (VBR V2)
VA_-_Hardstyle_Vocals-(LIMITED_EDITION)-2007-Jolf (CBR 128 kbps)
VA_-_Hardstyle_Vocals-(LIMITED_EDITION)-2007-Jolf (CBR 192 kbps)
VA_-_Hardstyle_Vocals-(LIMITED_EDITION)-2007-Jolf (CBR 160 kbps)
VA_-_Hardstyle_Vocals-(LIMITED_EDITION)-2007-Jolf (CBR 128 kbps)
VA_-_Hardstylerz_Megamix-2CD-2007-KTMP3 (VBR V2)
VA_-_Hb_4th_Year_Anniversary-Homemade-2CDR-2007-HB (VBR V2)
VA_-_History_Of_Hardstyle_Vol_4-CD-2007-SDS (VBR V2)
VA_-_History_Of_Hardstyle_Volume_5-CD-2007-QMI (VBR V2)
VA_-_Impact_3_Jump_And_Hardstyle-2CD-2007-KTMP3 (VBR V2)
VA_-_Impact_4_Jump_And_Hardstyle-2CD-2007-HB (VBR V2)
VA_-_Impact_5_Jump_And_Hardstyle-2CD-2007-KTMP3 (VBR V2)
VA_-_International_Tuning_Sounds_12-CD-2007-LiR (VBR V2)
VA_-_Italian_Hardstyle_Vol_11_Mixed_By_Technoboy-2CD-2007-QMI (VBR V2)
VA_-_Italian_Hardstyle_Vol_12-2CD-2007-QMI (VBR V2)
VA_-_Jac_Sampler_Vol.1_(JACSAMP001)-Vinyl-2007-JiM (VBR V2)
VA_-_Jack_Trax_Vol_1-(50HZ008)-Vinyl-2007-FMC (VBR V2)


VA_-_Jump_And_Bump_EP_Volume_One-(LC14603)-Vinyl-2007-FMC (VBR V2)
VA_-_Jump_Around_2-2CD-2007-KTMP3 (VBR V2)
VA_-_Jump_Up_The_Bass_Vinyl_Sampler_001-(JUTB001)-Vinyl-2007-HB (VBR V2)
VA_-_Jumpmasters_Sampler_Vol_1-(JM_SAMPLER_001)-Vinyl-2007-HB (VBR V2)
VA_-_Jumpstyle_And_Hardstyle_2008-(426013-0520557)-WEB-2007-eST (CBR 320 kbps)
VA_-_Jumpstyle_Part_3_Binum_vs_Oxley-2CD-2007-HB (VBR V2)
VA_-_Kanguru_Rec_2-(KANG1002)-Vinyl-2007-HB (VBR V2)
VA_-_La_Grotte_Electro_Night_Fever-CD-2007-FQS (VBR V2)
VA_-_Megahard_Vol_1-2CD-2007-ZzZz (VBR V2)
VA_-_Megajump_Best_In_Jumpstyle_Vol._1-2CD-2007-JiM (VBR V2)
VA_-_Monster_Beatz_Mixed_By_Dj_Furax-CD-2007-KTMP3 (VBR V2)
VA_-_Oxa_Hardstyle_Night__Mixed_By_Max_B_Grant-CD-2007-QMI (VBR V2)
VA_-_Promo_Only_CLOUD_9_Dance_MIDEM_Sampler-Promo_CD-2007-USZ (VBR V2)
VA_-_Pyromaniac_E.P._(BND002)-Vinyl-2007-NBD (VBR V2)
VA_-_Qlimax_2007_Dj_Format-CD-WEB-2007 (CBR 192 kbps)
VA_-_Qlimax_2007_Dj_Format-CD-WEB-2007 (CBR 320 kbps)
VA_-_Qlimax_2007_Dj_Format-CD-WEB-2007 (CBR 192 kbps)
VA_-_Qlimax_2007_Mixed_By_Headhunterz-CD-2008-THSLIVE (VBR V2)
VA_-_Qlimax_2007_The_Collection-CD-2007-THSLIVE (VBR V0)
VA_-_Qlimax_2007_The_Collection-Repack-CD-2007-THSLIVE (VBR V2)
VA_-_Qlimax_2007-Dvd-2008-FQS (VBR V2)
VA_-_Qlubtempo_2001_2007_The_Works-3CD-2007-KTMP3 (VBR V2)
VA_-_QMI_4rd_Anniversary__Mixed_By_Team_QMI-3CD-2007-QMI_INT (VBR V2)
VA_-_Radioactive_Edition_Sampler_4-(ATMR4)-Vinyl-2007-HB (VBR V2)
VA_-_Radioactive_Edition_Sampler_5_(ATMR5)-Vinyl-2007-KTB (VBR V2)
VA_-_Real_Hardstyle-CD-2007-HB (VBR V2)
VA_-_Retro_Arena_2-2CD-2007-FQS (VBR V2)
VA_-_Reverze_The_Compilation_(MIXED_BY_DJ_COONE)-CD-2007-KTMP3 (VBR V2)
VA_-_Scantraxx_Remixed_001-(SCANTRAXX030)-Vinyl-2007-HB (VBR V2)
VA_-_Sensation_Belgium_The_Megamixes-CD-2007-KTMP3 (VBR V2)
VA_-_Sensation_Black-2CD-2007-KTMP3 (VBR V2)
VA_-_Shock_Compilation_Volume_Iv__Mixed_By_Bruno_Power-CD-2007-QMI (VBR V2)
VA_-_Showtek-Today_is_Tomorrow-(DMWCD001)-PROPER-2CD-2007-HDF (VBR V2)
VA_-_Sigma_Gold_Ep_Vol_8-Vinyl-2007-QMI (VBR V2)
VA_-_SR_Allstars_EP-(SR002)-Vinyl-2007-FQS (VBR V2)
VA_-_Stars_Ep_Part_7-(STK130)-Vinyl-2007-HB (VBR V2)
VA_-_Summer_Festival_2007_(THE_COMPILATION)-CD-2007-HB (VBR V2)
VA_-_Syndicate-3CD-2007-MOD (VBR V2)
VA_-_Techno_Club_Selection_6_(ATL_263-2)-CD-2007-iHQ (VBR V2)
VA_-_Techno_Club_Selection_Vol_7-CD-2007-QMI (VBR V2)
VA_-_Techno_Club_Selection_Vol_8-CD-2007-QMI (VBR V2)
VA_-_Techno_Collector_3-(RM-SP04)-Vinyl-2007-UNiCORN (VBR V2)
VA_-_Techno_Collector_Sampler_2-(RM-SP03)-Vinyl-2007-HB_INT (VBR V2)
VA_-_Techno_Collector_Vol_2-(RM-CDMP02)-Proper-CD-2007-Oxd (VBR V2)
VA_-_Techno_Collector_Volume_3-CD-2007-FQS (VBR V2)
VA_-_Techno_Fusion_2007_Volume_1-(BABAFU002)-Vinyl-2007-HB (VBR V2)
VA_-_Techno_Lab_Experiment_One-WEB-2007-eST (CBR 320 kbps)
VA_-_Techno_Top_100_Vol._9-2CD-2007-SYNDIKAT (VBR V2)
VA_-_Techno_Top_100_Vol.10-2CD-2007-SYNDIKAT (VBR V2)
VA_-_Technodome_Vol_14__Mixed_By_Luca_Antolini_Dj_And_Technoboy-CD-2007-QMI (VBR V2)
VA_-_Technodome_Vol_15__Mixed_By_Luca_Antolini_Dj_And_Technoboy-CD-2007-QMI (VBR V2)
VA_-_The_United_EP_Volume_1_(T3H927)-Vinyl-2007-NRG (VBR V2)
VA_-_Titanic_Remix_Collection_Vol_4_Part_2_(TTC036)-Vinyl-2007-NBD (VBR V2)
VA_-_Tuning_Beats_2007_Volume_1-CD-2007-KTMP3 (VBR V2)
VA_-_Tuning_Beats_2007_Volume_2_Dj_Format-2CD-2007-KTMP3 (VBR V2)
VA_-_Tuning_Beats_2007_Volume_2-CD-2007-KTMP3 (VBR V2)
VA_-_Tuning_Beats_2007_Volume_3_Dj_Format-2CD-2007-LiR (VBR V2)
VA_-_Tuning_Beats_2007_Volume_3-CD-2007-KTMP3 (VBR V2)
VA_-_Tuning_Beats_2007_Volume_4-3CD-2007-KTMP3 (VBR V2)
VA_-_Tuning_Beats_Sampler-(TB003)-REPACK-Vinyl-2007-HB (VBR V2)
VA_-_Tuning_Beats_Sampler-(TB003)-Vinyl-2007-HB (VBR V2)
VA_-_Tuning_Mania_Vol_1_(Mixed_By_Bruno_Power_And_Julian_Dj)-(Shtl057)-CD-2007-iHQ (VBR V2)
VA_-_Tunnel_Club_Presents_Hardstyle_Germany_Vol_1-2CD-2007-MOD (VBR V2)
VA_-_Ultra_Bass_Vol._1-2CD-2007-JiM (VBR V2)
VA_-_Versus_(DJ_LB_BIRTHDAY)-CD-2007-FQS (VBR V2)
VA_-_X-Plosive_Techno_Hardstyle-2CD-2007-KTMP3 (VBR V2)
VA_-_XTC_Music_1_Year_Of_Harder_Stylez_Mixed_By_DJ_JB-CD-2007-XTC_Only (CBR 192 kbps)
VA_-_Xtc_Music_1_Year_Of_Pounding_Beatz_Mixed_By_Illusion-CD-2007-Xtc_Only (CBR 192 kbps)
VA_-_Yahoo_EP_(EP02)-Vinyl-2007-NRG (VBR V2)


VA-1000_Km_Of_Hell_(FAT008)-Vinyl-2007-NBD (VBR V2)
VA-Activa_Ep_Vol_4-Vinyl-2007-SND (VBR V2)
VA-Bass_Monster_Volume_3-2007-R3D (VBR V2)
VA-Better_Living_Through_Chemistry-(SUGARFREE01)-Vinyl-2007-hM (VBR V2)
VA-Blip_Blip-(At001)-Vinyl-2007-Def (VBR V2)
VA-Bounce_Christmas_Edition-2CD-CDR-2007-NBD (VBR V2)
VA-Burned_Style_Vol_1_(BND003)-Vinyl-2007-NBD (VBR V2)
VA-Butterfly_Hard_Stuff_E.p_(BTE011)-Vinyl-2007-NBD (VBR V2)
VA-Butterfly_Hard_Stuff_Ep-(BTE011)-WEB-2007-Homely (CBR 320 kbps)
VA-Cally_And_Juice_Volume_19-Promo_Cd-2007-HDF (VBR V2)
VA-Children_Of_Chaos-(EK02)-Vinyl-2007-hM (VBR V2)
VA-Dance_Pollution_Remix_Collection_Vol_2-(Vinyl)-2007-DELTA (VBR V2)
VA-Defqon_One_Festival_2007_Showtek_Exclusive_Mix-2007-DOH (VBR V2)
VA-Defqon_One_Festival_2007-Dvd-2007-Baggerzooi (VBR V2)
VA-Defqon_One_Festival_2007-DVD-REPACK-2007-BAGGERZOOi (VBR V2)
VA-Explosive_EP_Vol_1-(EXP051)-Vinyl-2007-MTC (VBR V2)
VA-Explosive_Ep_Vol_1-(EXP051)-WEB-2007-Homely (CBR 320 kbps)
VA-Freaky_Music_Hot_Tracks_Vol_12_(MIDEM_2007)-Promo_Cd-2007-TWCMP3 (VBR V2)
VA-Hard_Music_Vol._2_mixed_by_phutureboy-bootleg-2007-eMF (VBR V2)
VA-Hard_Session_Vol_01-(BOOTLEG)-2007-Nightshift (VBR V2)
VA-Hardbeatz_Collectors_Box_Vol_3-4cd-2007-Smo (VBR V2)
VA-Hardbeatz_Vol_9-2CD-2007-ZzZz (VBR V2)
VA-Hardstyle_Power_Compilation_(SMILAX220)-Retail-2007-Hft (VBR V2)
VA-Hardstyle_Revolution_Vol_2-Proper-2CD-2007-SDS (VBR V2)
VA-Im_Hardstyle_Vol_4_Mixed_By_Zenith_Dj-2CD-2007-SDS (VBR V2)
VA-In_Qontrol_Sound_Expander-3CD-2007-HDF (VBR V2)
VA-In_The_Ass-(FAT007)-Vinyl-2007-MTC (VBR V2)
VA-Italian_Hardtraxx_Vol._1_(HFCD001)-CD-2007-hft (VBR V2)
VA-Jumpin_Valley_Summer_Session-CD-2007-TRa (VBR V2)
VA-Lords_of_Hardstyle_Volume_2-2CD-2007-HDF (VBR V2)
VA-Mind_Traveling-(AT06)-Vinyl-2007-hM (VBR V2)
VA-Nickelodeon_Presents_Jump_For_Kids_2-2007-NBNL (VBR V2)
VA-Qlimax_2006_(MIXED_BY_ALPHA_TWINS)-2007-DOH (VBR V2)
VA-Qlimax_2007_Mixed_By_The_Headhunterz-2008-FRAY (VBR V2)
VA-Qlimax_2007_The_Compilation-WEB-Readnfo-2007-Homely (CBR 192 kbps)
VA-Qlimax_2007_The_Compilation-WEB-Readnfo-2007-Homely (CBR 320 kbps)
VA-Qlimax_2007_The_Compilation-WEB-Readnfo-2007-Homely (CBR 192 kbps)
VA-Sanctuary_Festival_07_Hardstyle-6CD-2007-UKHx (VBR V2)
VA-Sigma_Gold_Vol_7-Vinyl-2007-SDS (VBR V2)
VA-Sub_Fucker_Mixed_By_Bizerk-Proper-Bootleg-2007-eMF (VBR V2)
VA-Sub_Fucker_Mixed_By_Dj_Bizerk-Bootleg-2007-GT4 (VBR V2)
VA-Survival_Guide-(TSU013)-Vinyl-2007-MTC (VBR V2)
VA-The_United_Ep_Volume_2-(T3H928)-WEB-2007-ZzZz (CBR 320 kbps)
VA-Titanic_Remix_Collection_Vol_4_Part_1-(TTC035)-Vinyl-2007-DELTA (VBR V2)
VA-Transmission_Magic_City-Mixed_By_Bas_And_Ram_And_Dj_Zany-2CD-2007-DOC (VBR V2)
VA-Zenith-(ATM04)-Vinyl-2007-hM (VBR V2)

Other versions

Download links

Report invalid link

This question is for testing whether you are a human visitor and to prevent automated spam submissions.
Enter the code without spaces and pay attention to upper/lower case.

Comments ( 3 )

Thanks hero:)


miss HS2007-E.part07.rar


néodarkns wrote:
miss HS2007-E.part07.rar


Post new comment

Dont ask for zippy. All reuploads/requests here: http://xprm.net Avoid abusive language. Write in English if you wanna get answers. Advertising & spam is not allowed.
The content of this field is kept private and will not be shown publicly.
This question is for testing whether you are a human visitor and to prevent automated spam submissions.
Enter the code without spaces and pay attention to upper/lower case.